The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((5-(3-methoxyphenyl)-4-(methylamino)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile ID: ALA4570849
PubChem CID: 155562596
Max Phase: Preclinical
Molecular Formula: C23H25N7O2
Molecular Weight: 431.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNc1nc(Nc2cnc(C#N)c(OC3CCCNC3)c2)ncc1-c1cccc(OC)c1
Standard InChI: InChI=1S/C23H25N7O2/c1-25-22-19(15-5-3-6-17(9-15)31-2)14-28-23(30-22)29-16-10-21(20(11-24)27-12-16)32-18-7-4-8-26-13-18/h3,5-6,9-10,12,14,18,26H,4,7-8,13H2,1-2H3,(H2,25,28,29,30)
Standard InChI Key: QPJVWBGROWXSIX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.3333 -4.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0484 -4.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0448 -5.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7594 -6.2313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4744 -5.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4704 -4.9879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7553 -4.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1903 -6.2280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9038 -5.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6156 -6.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3287 -5.8134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3267 -4.9873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6058 -4.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8956 -4.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0397 -4.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7527 -4.1559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6004 -3.7515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3125 -3.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0247 -3.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7347 -3.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7337 -2.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0164 -2.0950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3002 -2.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7506 -3.7549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4629 -3.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3351 -3.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6209 -3.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9055 -3.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9089 -4.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6238 -4.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6205 -2.5199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3351 -2.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
15 16 3 0
13 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
7 24 1 0
24 25 1 0
2 1 1 0
1 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 1 1 0
27 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.50Molecular Weight (Monoisotopic): 431.2070AlogP: 3.33#Rotatable Bonds: 7Polar Surface Area: 117.01Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.89CX Basic pKa: 9.37CX LogP: 2.30CX LogD: 0.74Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -0.92
References 1. Tong L, Song P, Jiang K, Xu L, Jin T, Wang P, Hu X, Fang S, Gao A, Zhou Y, Liu T, Li J, Hu Y.. (2019) Discovery of (R)-5-((5-(1-methyl-1H-pyrazol-4-yl)-4-(methylamino)pyrimidin-2-yl)amino)-3-(piperidin-3-yloxy)picolinonitrile, a novel CHK1 inhibitor for hematologic malignancies., 173 [PMID:30986571 ] [10.1016/j.ejmech.2019.03.062 ]