N-(3-((1H-imidazol-2-yl)methylcarbamoyl)-1-methyl-1H-pyrazol-4-yl)-2'-(cyclopropylmethylamino)-2,4'-bipyridine-6-carboxamide

ID: ALA4570872

PubChem CID: 117872890

Max Phase: Preclinical

Molecular Formula: C24H25N9O2

Molecular Weight: 471.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cc(NC(=O)c2cccc(-c3ccnc(NCC4CC4)c3)n2)c(C(=O)NCc2ncc[nH]2)n1

Standard InChI:  InChI=1S/C24H25N9O2/c1-33-14-19(22(32-33)24(35)29-13-21-26-9-10-27-21)31-23(34)18-4-2-3-17(30-18)16-7-8-25-20(11-16)28-12-15-5-6-15/h2-4,7-11,14-15H,5-6,12-13H2,1H3,(H,25,28)(H,26,27)(H,29,35)(H,31,34)

Standard InChI Key:  WSGGEYUNGXSNTI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   35.0635   -1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0624   -2.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7704   -2.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4801   -2.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4772   -1.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7686   -1.2379    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7721   -3.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0627   -4.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0621   -4.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7703   -5.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4804   -4.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4775   -4.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3557   -1.2383    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.6481   -1.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9403   -1.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5293   -0.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1209   -1.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1895   -5.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1921   -6.1347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.8958   -4.9066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4858   -6.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7334   -6.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1885   -6.8275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5995   -7.5339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3982   -7.3612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0058   -7.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8364   -8.7071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7829   -7.6547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3756   -6.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3905   -8.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2211   -9.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4791   -9.3353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.5651  -10.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3645  -10.3174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7726   -9.6094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
  1 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 15 17  1  0
 11 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
 23 29  1  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 31  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

IRAK4 Tchem Interleukin-1 receptor-associated kinase 4 (5917 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.53Molecular Weight (Monoisotopic): 471.2131AlogP: 2.60#Rotatable Bonds: 9
Polar Surface Area: 142.51Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.89CX Basic pKa: 6.80CX LogP: 2.11CX LogD: 2.08
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -1.83

References

1. Hanisak J, Seganish WM, McElroy WT, Tang H, Zhang R, Tsui HC, Fischmann T, Tulshian D, Tata J, Sondey C, Devito K, Fossetta J, Garlisi CG, Lundell D, Niu X..  (2016)  Efforts towards the optimization of a bi-aryl class of potent IRAK4 inhibitors.,  26  (17): [PMID:27476420] [10.1016/j.bmcl.2016.07.048]

Source