The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((1H-imidazol-2-yl)methylcarbamoyl)-1-methyl-1H-pyrazol-4-yl)-2'-(cyclopropylmethylamino)-2,4'-bipyridine-6-carboxamide ID: ALA4570872
PubChem CID: 117872890
Max Phase: Preclinical
Molecular Formula: C24H25N9O2
Molecular Weight: 471.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(NC(=O)c2cccc(-c3ccnc(NCC4CC4)c3)n2)c(C(=O)NCc2ncc[nH]2)n1
Standard InChI: InChI=1S/C24H25N9O2/c1-33-14-19(22(32-33)24(35)29-13-21-26-9-10-27-21)31-23(34)18-4-2-3-17(30-18)16-7-8-25-20(11-16)28-12-15-5-6-15/h2-4,7-11,14-15H,5-6,12-13H2,1H3,(H,25,28)(H,26,27)(H,29,35)(H,31,34)
Standard InChI Key: WSGGEYUNGXSNTI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
35.0635 -1.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0624 -2.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7704 -2.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4801 -2.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4772 -1.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7686 -1.2379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7721 -3.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0627 -4.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0621 -4.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7703 -5.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4804 -4.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4775 -4.0962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3557 -1.2383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6481 -1.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9403 -1.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5293 -0.5282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1209 -1.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1895 -5.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1921 -6.1347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8958 -4.9066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4858 -6.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7334 -6.2184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1885 -6.8275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5995 -7.5339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3982 -7.3612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0058 -7.9077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8364 -8.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7829 -7.6547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.3756 -6.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3905 -8.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2211 -9.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4791 -9.3353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5651 -10.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3645 -10.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7726 -9.6094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
1 13 1 0
13 14 1 0
14 15 1 0
16 15 1 0
17 16 1 0
15 17 1 0
11 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
25 26 1 0
26 27 2 0
26 28 1 0
23 29 1 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.53Molecular Weight (Monoisotopic): 471.2131AlogP: 2.60#Rotatable Bonds: 9Polar Surface Area: 142.51Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.89CX Basic pKa: 6.80CX LogP: 2.11CX LogD: 2.08Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -1.83
References 1. Hanisak J, Seganish WM, McElroy WT, Tang H, Zhang R, Tsui HC, Fischmann T, Tulshian D, Tata J, Sondey C, Devito K, Fossetta J, Garlisi CG, Lundell D, Niu X.. (2016) Efforts towards the optimization of a bi-aryl class of potent IRAK4 inhibitors., 26 (17): [PMID:27476420 ] [10.1016/j.bmcl.2016.07.048 ]