1-(4-(4-Methylpiperazin-1-yl)phenyl)-8,9-dihydro-2,4,7,9a-tetraazabenzo[cd]azulen-6(7H)-one

ID: ALA4570886

PubChem CID: 155562830

Max Phase: Preclinical

Molecular Formula: C20H22N6O

Molecular Weight: 362.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(-c3nc4cncc5c4n3CCNC5=O)cc2)CC1

Standard InChI:  InChI=1S/C20H22N6O/c1-24-8-10-25(11-9-24)15-4-2-14(3-5-15)19-23-17-13-21-12-16-18(17)26(19)7-6-22-20(16)27/h2-5,12-13H,6-11H2,1H3,(H,22,27)

Standard InChI Key:  SGPLMYUKLQIIKO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
   10.6483  -10.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1681  -11.6326    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3868  -11.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3868  -10.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6777  -10.1481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5869   -9.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1693   -8.7549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9824   -8.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4264   -9.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1681  -10.3061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9686  -10.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9686  -11.3780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6777  -11.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8158   -9.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4696  -10.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8782  -10.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6995  -10.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1081  -10.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6995  -11.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8782  -11.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9294  -10.9694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3380  -10.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1594  -10.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5679  -10.9694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1594  -11.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3380  -11.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3929  -10.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 10  1  0
  4 10  1  0
 11 12  2  0
 12 13  1  0
  3 13  2  0
  5 11  1  0
  6 14  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 15 20  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 26  1  0
 18 21  1  0
  1 15  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570886

    ---

Associated Targets(Human)

PARP2 Tclin Poly [ADP-ribose] polymerase 2 (1185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PARP1 Tclin Poly [ADP-ribose] polymerase-1 (6206 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.44Molecular Weight (Monoisotopic): 362.1855AlogP: 1.59#Rotatable Bonds: 2
Polar Surface Area: 66.29Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.82CX LogP: 1.15CX LogD: 0.59
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.75Np Likeness Score: -1.01

References

1. Li H, Hu Y, Wang X, He G, Xu Y, Zhu Q..  (2016)  Novel tricyclic poly (ADP-ribose) polymerase-1/2 inhibitors with potent anticancer chemopotentiating activity: Design, synthesis and biological evaluation.,  24  (19): [PMID:27561983] [10.1016/j.bmc.2016.08.016]

Source