The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(1-Adamantylmethoxylmethyl)-3-pentylbenzo[d]thiazol-2(3H)-one ID: ALA4571345
PubChem CID: 155562737
Max Phase: Preclinical
Molecular Formula: C24H33NO2S
Molecular Weight: 399.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCn1c(=O)sc2cc(C(OC)C34CC5CC(CC(C5)C3)C4)ccc21
Standard InChI: InChI=1S/C24H33NO2S/c1-3-4-5-8-25-20-7-6-19(12-21(20)28-23(25)26)22(27-2)24-13-16-9-17(14-24)11-18(10-16)15-24/h6-7,12,16-18,22H,3-5,8-11,13-15H2,1-2H3
Standard InChI Key: LQUPDSZZPSGSPB-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
15.0090 -27.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0079 -28.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7159 -28.9888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7141 -27.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4227 -27.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4275 -28.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2076 -28.8237 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.6849 -28.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1998 -27.4992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5021 -28.1538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2998 -28.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5924 -28.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2992 -29.8050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5160 -29.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1512 -28.5023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3087 -28.9565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8517 -28.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0584 -29.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3061 -28.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8574 -27.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1468 -27.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6024 -27.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1940 -26.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8988 -26.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6094 -26.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3142 -26.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0248 -26.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0066 -30.2142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
2 11 1 0
11 12 1 0
11 13 1 0
14 15 1 0
14 16 1 0
15 17 1 0
16 18 1 0
17 12 1 0
18 12 1 0
19 20 1 0
16 19 1 0
15 21 1 0
12 22 1 0
22 20 1 0
20 21 1 0
9 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
13 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.60Molecular Weight (Monoisotopic): 399.2232AlogP: 6.16#Rotatable Bonds: 7Polar Surface Area: 31.23Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.98CX LogD: 5.98Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.52Np Likeness Score: -0.69
References 1. Leleu-Chavain N, Baudelet D, Heloire VM, Rocha DE, Renault N, Barczyk A, Djouina M, Body-Malapel M, Carato P, Millet R.. (2019) Benzo[d]thiazol-2(3H)-ones as new potent selective CB2 agonists with anti-inflammatory properties., 165 [PMID:30583970 ] [10.1016/j.ejmech.2018.12.008 ]