4-hydroxy-3-(2-(4-hydroxyphenyl)-2-oxo-1-(piperidin-1-yl)ethyl)-2H-chromen-2-one

ID: ALA4571358

PubChem CID: 155562811

Max Phase: Preclinical

Molecular Formula: C22H21NO5

Molecular Weight: 379.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(O)cc1)C(c1c(O)c2ccccc2oc1=O)N1CCCCC1

Standard InChI:  InChI=1S/C22H21NO5/c24-15-10-8-14(9-11-15)20(25)19(23-12-4-1-5-13-23)18-21(26)16-6-2-3-7-17(16)28-22(18)27/h2-3,6-11,19,24,26H,1,4-5,12-13H2

Standard InChI Key:  LOQIHCPOPNJLHC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    5.6034   -8.2627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6022   -9.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3103   -9.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3085   -7.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0171   -8.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0159   -9.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7221   -9.4888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4340   -9.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4352   -8.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7244   -7.8475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7245   -7.0303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1406   -9.4923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1439   -7.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8506   -8.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1458   -7.0370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8486   -9.0817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5593   -7.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2616   -8.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9698   -7.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9722   -7.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2605   -6.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5552   -7.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6804   -6.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8584   -6.6352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8624   -5.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1575   -5.4075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4470   -5.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4414   -6.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
  8 12  2  0
  9 13  1  0
 13 14  1  0
 13 15  1  0
 14 16  2  0
 14 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 15 24  1  0
 15 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4571358

    ---

Associated Targets(Human)

HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Lactobacillus jensenii (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 379.41Molecular Weight (Monoisotopic): 379.1420AlogP: 3.61#Rotatable Bonds: 4
Polar Surface Area: 90.98Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.53CX Basic pKa: 6.92CX LogP: 1.24CX LogD: 0.64
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: -0.14

References

1. Singh H, Singh JV, Bhagat K, Gulati HK, Sanduja M, Kumar N, Kinarivala N, Sharma S..  (2019)  Rational approaches, design strategies, structure activity relationship and mechanistic insights for therapeutic coumarin hybrids.,  27  (16): [PMID:31255497] [10.1016/j.bmc.2019.06.033]

Source