The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N10-Bis(4-((4,5-dihydroisoxazol-3-yl)oxy)but-2-yn-1-yl)-N1,N1,N10,N10-tetramethyldecane-1,10-diaminium bromide ID: ALA4571387
PubChem CID: 155562520
Max Phase: Preclinical
Molecular Formula: C28H48Br2N4O4
Molecular Weight: 504.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[N+](C)(CC#CCOC1=NOCC1)CCCCCCCCCC[N+](C)(C)CC#CCOC1=NOCC1.[Br-].[Br-]
Standard InChI: InChI=1S/C28H48N4O4.2BrH/c1-31(2,21-13-15-23-33-27-17-25-35-29-27)19-11-9-7-5-6-8-10-12-20-32(3,4)22-14-16-24-34-28-18-26-36-30-28;;/h5-12,17-26H2,1-4H3;2*1H/q+2;;/p-2
Standard InChI Key: KKWMJTBCZCDULU-UHFFFAOYSA-L
Molfile:
RDKit 2D
38 37 0 0 0 0 0 0 0 0999 V2000
30.8600 -10.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5759 -11.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2876 -10.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0035 -11.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7151 -10.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4310 -11.0588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4310 -11.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1510 -10.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8627 -11.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5745 -11.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2903 -11.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0020 -11.4713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7179 -11.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4723 -11.5463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0253 -12.1627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6128 -12.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8027 -12.7061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1469 -11.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2904 -11.8887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5746 -12.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8588 -11.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1471 -11.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4312 -11.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7194 -11.4762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7194 -12.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3849 -12.7859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1319 -13.5705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3069 -13.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0499 -12.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0022 -12.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2904 -11.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0022 -10.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2833 -12.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7173 -11.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4311 -10.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1463 -11.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5237 -13.2642 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
28.2470 -14.3270 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 1 0
8 9 1 0
9 10 3 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
13 17 1 0
6 18 1 0
19 20 1 0
20 21 1 0
21 22 3 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 1 0
25 29 1 0
19 30 1 0
19 31 1 0
31 32 1 0
19 33 1 0
32 34 1 0
34 35 1 0
35 36 1 0
36 1 1 0
M CHG 4 6 1 19 1 37 -1 38 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.72Molecular Weight (Monoisotopic): 504.3665AlogP: 3.77#Rotatable Bonds: 15Polar Surface Area: 61.64Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.05CX LogP: -3.84CX LogD: -3.84Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.19Np Likeness Score: 0.07
References 1. Agnetta L, Bermudez M, Riefolo F, Matera C, Claro E, Messerer R, Littmann T, Wolber G, Holzgrabe U, Decker M.. (2019) Fluorination of Photoswitchable Muscarinic Agonists Tunes Receptor Pharmacology and Photochromic Properties., 62 (6): [PMID:30827105 ] [10.1021/acs.jmedchem.8b01822 ]