The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Acetamidobenzyl)-2-(9H-carbazol-9-yl)-N-ethylacetamide ID: ALA4571475
PubChem CID: 155562523
Max Phase: Preclinical
Molecular Formula: C25H25N3O2
Molecular Weight: 399.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(Cc1ccc(NC(C)=O)cc1)C(=O)Cn1c2ccccc2c2ccccc21
Standard InChI: InChI=1S/C25H25N3O2/c1-3-27(16-19-12-14-20(15-13-19)26-18(2)29)25(30)17-28-23-10-6-4-8-21(23)22-9-5-7-11-24(22)28/h4-15H,3,16-17H2,1-2H3,(H,26,29)
Standard InChI Key: VYESHCDKCLVLGW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
3.7846 -24.4827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3760 -25.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1262 -24.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3312 -24.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7851 -25.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0396 -26.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8341 -26.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4476 -24.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1914 -25.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7333 -26.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5314 -26.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7848 -25.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2413 -24.7979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7829 -23.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4897 -23.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4880 -22.4382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1983 -23.6625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1948 -22.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7794 -22.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9034 -22.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9009 -23.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6087 -23.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3165 -23.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3121 -22.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6038 -22.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7776 -21.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0256 -23.6527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7319 -23.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4410 -23.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7291 -22.4245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 9 1 0
8 1 1 0
1 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
16 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.49Molecular Weight (Monoisotopic): 399.1947AlogP: 4.80#Rotatable Bonds: 6Polar Surface Area: 54.34Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -1.46
References 1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M.. (2019) First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold., 62 (17): [PMID:31419132 ] [10.1021/acs.jmedchem.9b00980 ]