N-(4-Acetamidobenzyl)-2-(9H-carbazol-9-yl)-N-ethylacetamide

ID: ALA4571475

PubChem CID: 155562523

Max Phase: Preclinical

Molecular Formula: C25H25N3O2

Molecular Weight: 399.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(Cc1ccc(NC(C)=O)cc1)C(=O)Cn1c2ccccc2c2ccccc21

Standard InChI:  InChI=1S/C25H25N3O2/c1-3-27(16-19-12-14-20(15-13-19)26-18(2)29)25(30)17-28-23-10-6-4-8-21(23)22-9-5-7-11-24(22)28/h4-15H,3,16-17H2,1-2H3,(H,26,29)

Standard InChI Key:  VYESHCDKCLVLGW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.7846  -24.4827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3760  -25.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1262  -24.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3312  -24.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7851  -25.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0396  -26.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8341  -26.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4476  -24.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1914  -25.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7333  -26.3459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5314  -26.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7848  -25.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2413  -24.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7829  -23.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4897  -23.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4880  -22.4382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1983  -23.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1948  -22.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7794  -22.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9034  -22.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9009  -23.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6087  -23.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3165  -23.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3121  -22.4252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6038  -22.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7776  -21.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0256  -23.6527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7319  -23.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4410  -23.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7291  -22.4245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
 23 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4571475

    ---

Associated Targets(Human)

TSPO Tchem Translocator protein (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.49Molecular Weight (Monoisotopic): 399.1947AlogP: 4.80#Rotatable Bonds: 6
Polar Surface Area: 54.34Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.75CX LogD: 3.75
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: -1.46

References

1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M..  (2019)  First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold.,  62  (17): [PMID:31419132] [10.1021/acs.jmedchem.9b00980]

Source