The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4R)-3-Hydroxy-4-methyl-2-(n-eicos-11'-yn-19'-enyl)but-2-enolide ID: ALA4571489
PubChem CID: 155562603
Max Phase: Preclinical
Molecular Formula: C25H40O3
Molecular Weight: 388.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCCCCCCC#CCCCCCCCCCCC1=C(O)[C@@H](C)OC1=O
Standard InChI: InChI=1S/C25H40O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(26)22(2)28-25(23)27/h3,22,26H,1,4-9,12-21H2,2H3/t22-/m1/s1
Standard InChI Key: TUMIGHLOHBQEQM-JOCHJYFZSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
18.7913 -8.6713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4542 -8.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1999 -7.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3827 -7.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1283 -8.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2311 -8.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9026 -6.7512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6799 -6.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4927 -6.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9728 -6.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7855 -6.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2656 -5.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0783 -5.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5584 -5.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3712 -5.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8514 -4.4472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6641 -4.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1444 -3.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6267 -3.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1106 -2.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9228 -2.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4068 -1.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2190 -2.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7029 -1.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5152 -1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9991 -0.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8113 -0.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3515 -8.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
2 3 1 0
1 2 1 0
3 4 2 0
5 1 1 0
2 6 2 0
4 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 3 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
5 28 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.59Molecular Weight (Monoisotopic): 388.2977AlogP: 7.17#Rotatable Bonds: 16Polar Surface Area: 46.53Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.84CX Basic pKa: ┄CX LogP: 8.41CX LogD: 6.84Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.13Np Likeness Score: 1.29
References 1. Oliveira EA, Brito IA, Lima ML, Romanelli M, Moreira-Filho JT, Neves BJ, Andrade CH, Sartorelli P, Tempone AG, Tempone AG, Costa-Silva TA, Lago JHG.. (2019) Antitrypanosomal Activity of Acetogenins Isolated from the Seeds of Porcelia macrocarpa Is Associated with Alterations in Both Plasma Membrane Electric Potential and Mitochondrial Membrane Potential., 82 (5): [PMID:31046273 ] [10.1021/acs.jnatprod.8b00890 ]