(4-(3-Aminophenyl)-1-(3-methylphenyl)-1H-pyrrol-3-yl)(3,4,5-trimethoxyphenyl)-methanone

ID: ALA4571506

PubChem CID: 155562638

Max Phase: Preclinical

Molecular Formula: C27H26N2O4

Molecular Weight: 442.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)c2cn(-c3cccc(C)c3)cc2-c2cccc(N)c2)cc(OC)c1OC

Standard InChI:  InChI=1S/C27H26N2O4/c1-17-7-5-10-21(11-17)29-15-22(18-8-6-9-20(28)12-18)23(16-29)26(30)19-13-24(31-2)27(33-4)25(14-19)32-3/h5-16H,28H2,1-4H3

Standard InChI Key:  ZWCYZKNSCKKXJA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   16.5050  -12.8177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3204  -12.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7273  -12.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3200  -11.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5014  -11.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0982  -12.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2810  -12.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8703  -11.4120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8745  -12.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4659  -14.0862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1289  -13.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0573  -12.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8030  -13.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6446  -12.1175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0560  -11.4056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6440  -10.6962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8219  -10.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4136  -11.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8280  -12.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4652  -14.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7559  -15.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7556  -16.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4638  -16.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1738  -16.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1707  -15.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7285  -13.5268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5445  -12.1145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7274  -10.6999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.5446  -10.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3193  -14.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9529  -12.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8830  -16.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0508   -9.9874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
 12 13  2  0
 11  9  2  0
 10 11  1  0
  9 12  1  0
 13 10  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 10 20  1  0
  2 26  1  0
  3 27  1  0
  4 28  1  0
 28 29  1  0
 26 30  1  0
 27 31  1  0
 24 32  1  0
 16 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4571506

    ---

Associated Targets(Human)

TUBB4B Tclin Tubulin (5180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.52Molecular Weight (Monoisotopic): 442.1893AlogP: 5.29#Rotatable Bonds: 7
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.78CX LogP: 5.25CX LogD: 5.25
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.55

References

1. Puxeddu M, Shen H, Bai R, Coluccia A, Nalli M, Mazzoccoli C, Da Pozzo E, Cavallini C, Martini C, Orlando V, Biagioni S, Mazzoni C, Coluccia AML, Hamel E, Liu T, Silvestri R, La Regina G..  (2020)  Structure-activity relationship studies and in vitro and in vivo anticancer activity of novel 3-aroyl-1,4-diarylpyrroles against solid tumors and hematological malignancies.,  185  [PMID:31727471] [10.1016/j.ejmech.2019.111828]

Source