(R)-4-isopropyl-N-(3-((4-methylpiperazin-1-yl)methyl)-5-(trifluoromethyl)phenyl)-2-(pyrimidin-5-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide

ID: ALA4571618

PubChem CID: 155562643

Max Phase: Preclinical

Molecular Formula: C30H35F3N6O

Molecular Weight: 552.65

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)[C@H]1CN(c2cncnc2)Cc2cc(C(=O)Nc3cc(CN4CCN(C)CC4)cc(C(F)(F)F)c3)ccc21

Standard InChI:  InChI=1S/C30H35F3N6O/c1-20(2)28-18-39(26-14-34-19-35-15-26)17-23-12-22(4-5-27(23)28)29(40)36-25-11-21(10-24(13-25)30(31,32)33)16-38-8-6-37(3)7-9-38/h4-5,10-15,19-20,28H,6-9,16-18H2,1-3H3,(H,36,40)/t28-/m1/s1

Standard InChI Key:  NOVCCZLKNWAHGH-MUUNZHRXSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    6.2702  -10.1287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2702   -9.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9850   -8.8889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6957   -9.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4105   -8.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1253   -9.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1253  -10.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4105  -10.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4105  -11.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1253  -11.7763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8359  -11.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5507  -11.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5507  -12.6001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2655  -13.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8359  -13.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1253  -12.6001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6957  -10.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5555   -8.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8448   -9.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1299   -8.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1299   -8.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4151   -7.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7003   -8.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7003   -8.8889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9897   -9.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9897  -10.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2749  -10.5406    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5642  -10.1287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5642   -9.3008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2749   -8.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4151   -9.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8448   -7.6532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5555   -8.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8385   -8.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4875   -8.5097    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6434   -9.1903    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.9755   -8.0348    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4151   -6.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1285   -6.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7017   -6.4175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 10 16  1  0
  8 17  2  0
  4 17  1  0
  2 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
 24 31  1  0
 20 31  1  0
 21 32  1  0
 32 33  2  0
 18 33  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
  6 34  1  0
 22 38  1  6
 38 39  1  0
 38 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4571618

    ---

Associated Targets(Human)

ABL1 Tclin Tyrosine-protein kinase ABL (18331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DDR1 Tchem Epithelial discoidin domain-containing receptor 1 (1050 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 552.65Molecular Weight (Monoisotopic): 552.2824AlogP: 5.25#Rotatable Bonds: 6
Polar Surface Area: 64.60Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.65CX LogP: 4.78CX LogD: 4.33
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.45Np Likeness Score: -1.16

References

1. Wang Z, Bian H, Bartual SG, Du W, Luo J, Zhao H, Zhang S, Mo C, Zhou Y, Xu Y, Tu Z, Ren X, Lu X, Brekken RA, Yao L, Bullock AN, Su J, Ding K..  (2016)  Structure-Based Design of Tetrahydroisoquinoline-7-carboxamides as Selective Discoidin Domain Receptor 1 (DDR1) Inhibitors.,  59  (12): [PMID:27219676] [10.1021/acs.jmedchem.6b00140]

Source