The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1-methyl-9-(3,4,5-trimethoxybenzyl)-9H-pyrido[3,4-b]indol-6-yl)ethanone ID: ALA4571746
PubChem CID: 155562941
Max Phase: Preclinical
Molecular Formula: C24H24N2O4
Molecular Weight: 404.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Cn2c3ccc(C(C)=O)cc3c3ccnc(C)c32)cc(OC)c1OC
Standard InChI: InChI=1S/C24H24N2O4/c1-14-23-18(8-9-25-14)19-12-17(15(2)27)6-7-20(19)26(23)13-16-10-21(28-3)24(30-5)22(11-16)29-4/h6-12H,13H2,1-5H3
Standard InChI Key: RLCHXBNVDNOTRG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
13.0282 -8.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0271 -9.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7351 -10.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7334 -8.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4420 -8.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4422 -9.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2252 -9.8771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2248 -8.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7058 -9.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5220 -9.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8582 -8.3781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3721 -7.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5577 -7.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4788 -10.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0008 -9.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3204 -8.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3202 -7.5777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6128 -8.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9328 -11.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1357 -11.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5899 -11.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8433 -12.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6476 -12.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1898 -12.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9036 -13.4174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7037 -13.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2990 -13.0836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5536 -13.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7914 -11.5290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2451 -12.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 1 0
10 15 1 0
1 16 1 0
16 17 2 0
16 18 1 0
14 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 1 0
23 25 1 0
27 28 1 0
22 27 1 0
29 30 1 0
21 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.47Molecular Weight (Monoisotopic): 404.1736AlogP: 4.77#Rotatable Bonds: 6Polar Surface Area: 62.58Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.59CX LogP: 3.04CX LogD: 3.03Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -0.23
References 1. Du H, Tian S, Chen J, Gu H, Li N, Wang J.. (2016) Synthesis and biological evaluation of N(9)-substituted harmine derivatives as potential anticancer agents., 26 (16): [PMID:27397495 ] [10.1016/j.bmcl.2016.06.087 ]