The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pobeguinine ID: ALA4571926
PubChem CID: 155563291
Max Phase: Preclinical
Molecular Formula: C20H20N2O3
Molecular Weight: 336.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1/COC(=O)[C@H]2C(=O)N3CCc4c([nH]c5ccccc45)[C@@H]3C[C@@H]12
Standard InChI: InChI=1S/C20H20N2O3/c1-2-11-10-25-20(24)17-14(11)9-16-18-13(7-8-22(16)19(17)23)12-5-3-4-6-15(12)21-18/h2-6,14,16-17,21H,7-10H2,1H3/b11-2-/t14-,16-,17+/m0/s1
Standard InChI Key: BKIFWXBEJYBPMT-BXWXAXRQSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
31.4435 -12.4047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4665 -13.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4654 -14.4806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1734 -14.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1716 -13.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8802 -13.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8805 -14.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6591 -14.7289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.6587 -13.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1406 -14.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8100 -12.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9903 -12.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5344 -14.6888 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.2906 -13.2350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9512 -13.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4291 -14.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1080 -13.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5882 -13.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2488 -14.5684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7233 -15.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5394 -15.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8788 -14.4080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4021 -13.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3841 -15.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5707 -16.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7391 -12.9939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8345 -15.2707 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.9901 -13.1081 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 6 1 0
9 10 2 0
9 12 1 0
10 15 1 0
14 11 1 0
11 12 1 0
15 13 1 6
14 15 1 0
14 17 1 0
15 16 1 0
16 19 1 0
18 17 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
17 1 2 0
20 24 2 0
24 25 1 0
23 26 2 0
19 27 1 1
18 28 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 336.39Molecular Weight (Monoisotopic): 336.1474AlogP: 2.73#Rotatable Bonds: ┄Polar Surface Area: 62.40Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.40CX Basic pKa: ┄CX LogP: 2.11CX LogD: 2.11Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.46Np Likeness Score: 1.34
References 1. Kezetas Bankeu JJ, Kenou Kagho DU, Fotsing Fongang YS, Kouipou Toghueo RM, Mba'ning BM, Tchouya Feuya GR, Boyom Fekam F, Tchouankeu JC, Ngouela SA, Sewald N, Lenta BN, Ali MS.. (2019) Constituents from Nauclea latifolia with Anti-Haemophilus influenzae Type b Inhibitory Activities., 82 (9): [PMID:31429278 ] [10.1021/acs.jnatprod.9b00463 ]