2-tert-butoxy-2-(3-(chroman-6-yl)-1-(3-methoxyphenyl)isoquinolin-4-yl)acetic acid

ID: ALA4572060

PubChem CID: 145999930

Max Phase: Preclinical

Molecular Formula: C31H31NO5

Molecular Weight: 497.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2nc(-c3ccc4c(c3)CCCO4)c(C(OC(C)(C)C)C(=O)O)c3ccccc23)c1

Standard InChI:  InChI=1S/C31H31NO5/c1-31(2,3)37-29(30(33)34)26-23-12-5-6-13-24(23)27(20-9-7-11-22(18-20)35-4)32-28(26)21-14-15-25-19(17-21)10-8-16-36-25/h5-7,9,11-15,17-18,29H,8,10,16H2,1-4H3,(H,33,34)

Standard InChI Key:  DZOXMBDLYPHUKG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   14.0435   -4.6183    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0424   -5.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4573   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7487   -4.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4601   -5.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7496   -5.8447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7481   -6.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4563   -7.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1675   -6.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1655   -5.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1634   -4.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8727   -4.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1604   -3.3863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8665   -2.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8634   -2.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5758   -3.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5696   -2.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8758   -5.4266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5788   -4.1981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3374   -5.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6293   -5.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9221   -5.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9218   -6.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6345   -7.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3388   -6.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7434   -3.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4515   -2.9850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4494   -2.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0367   -2.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0311   -2.1764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7357   -1.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7279   -0.9472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0173   -0.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3127   -0.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3189   -1.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6375   -7.8882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9313   -8.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 12 18  2  0
 12 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  2 20  1  0
 26 27  2  0
 27 28  1  0
 28 31  2  0
 30 29  2  0
 29 26  1  0
  4 26  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 24 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4572060

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 integrase (9041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.59Molecular Weight (Monoisotopic): 497.2202AlogP: 6.84#Rotatable Bonds: 6
Polar Surface Area: 77.88Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.44CX Basic pKa: 4.15CX LogP: 5.99CX LogD: 3.35
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -0.35

References

1. Wilson TA, Koneru PC, Rebensburg SV, Lindenberger JJ, Kobe MJ, Cockroft NT, Adu-Ampratwum D, Larue RC, Kvaratskhelia M, Fuchs JR..  (2019)  An Isoquinoline Scaffold as a Novel Class of Allosteric HIV-1 Integrase Inhibitors.,  10  (2): [PMID:30783506] [10.1021/acsmedchemlett.8b00633]

Source