BAY_771

ID: ALA4572210

PubChem CID: 155563095

Max Phase: Preclinical

Molecular Formula: C22H15F3N2O3

Molecular Weight: 412.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1Oc1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c2ccccc2c1

Standard InChI:  InChI=1S/C22H15F3N2O3/c1-13-6-2-5-9-18(13)30-15-10-14-7-3-4-8-16(14)17(11-15)27-20(28)12-19(22(23,24)25)26-21(27)29/h2-12H,1H3,(H,26,29)

Standard InChI Key:  LZLNIHXKWZZQLE-UHFFFAOYSA-N

Molfile:  

C22H15F3N2O3
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   11.3804  -24.2453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1516  -24.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0714  -26.2445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2201  -26.9968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1396  -28.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9085  -29.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8298  -30.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9815  -31.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2066  -30.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2878  -29.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5166  -28.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5939  -27.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8227  -26.5015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9028  -25.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1369  -24.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2856  -25.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2170  -23.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0661  -22.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8349  -23.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7555  -24.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4481  -26.3739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8422  -26.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7621  -28.2437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6931  -26.1156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7733  -24.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4681  -24.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4408  -25.2318    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3193  -23.5595    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.5482  -22.9362    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.0026  -24.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 14  2  0
 12 21  1  0
 21  4  2  0
 22  3  1  0
 22 23  2  0
 24 22  1  0
 25 24  1  0
 26 25  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 30 25  2  0
 30  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4572210

    BAY-771

Associated Targets(Human)

BCAT1 Tchem Branched-chain-amino-acid transferase (80 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BCAT2 Tchem Branched-chain-amino-acid aminotransferase, mitochondrial (199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 412.37Molecular Weight (Monoisotopic): 412.1035AlogP: 4.80#Rotatable Bonds: 3
Polar Surface Area: 64.09Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.04CX Basic pKa: CX LogP: 4.83CX LogD: 4.82
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.53Np Likeness Score: -0.73

References

1. SGC Frankfurt.  (2021)  Data for DCP probe BAY-069,  [10.6019/CHEMBL4507325]
2. Günther J, Hillig RC, Zimmermann K, Kaulfuss S, Lemos C, Nguyen D, Rehwinkel H, Habgood M, Lechner C, Neuhaus R, Ganzer U, Drewes M, Chai J, Bouché L..  (2022)  BAY-069, a Novel (Trifluoromethyl)pyrimidinedione-Based BCAT1/2 Inhibitor and Chemical Probe.,  65  (21.0): [PMID:36261130] [10.1021/acs.jmedchem.2c00441]
3. Bertrand, Sophie M SM and 31 more authors.  2015-09-24  The Discovery of in Vivo Active Mitochondrial Branched-Chain Aminotransferase (BCATm) Inhibitors by Hybridizing Fragment and HTS Hits.  [PMID:26090771]