Ethyl (E)-2-(4-chloro-3-(2-nitrovinyl)phenoxy)-2-methylpropanoate

ID: ALA4572293

PubChem CID: 155564495

Max Phase: Preclinical

Molecular Formula: C14H16ClNO5

Molecular Weight: 313.74

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C(C)(C)Oc1ccc(Cl)c(/C=C/[N+](=O)[O-])c1

Standard InChI:  InChI=1S/C14H16ClNO5/c1-4-20-13(17)14(2,3)21-11-5-6-12(15)10(9-11)7-8-16(18)19/h5-9H,4H2,1-3H3/b8-7+

Standard InChI Key:  PAJVAZDCAOOVIW-BQYQJAHWSA-N

Molfile:  

 
     RDKit          2D

 21 21  0  0  0  0  0  0  0  0999 V2000
   24.3465   -3.7269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7592   -4.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1677   -3.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9307   -3.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9295   -4.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6376   -4.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3472   -4.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3444   -3.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6358   -3.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0556   -4.8502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4710   -4.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1781   -4.4383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8864   -4.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4723   -5.6652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5935   -4.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6333   -2.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9244   -1.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9220   -1.1786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2139   -0.7749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6213   -0.7707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2229   -3.2152    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10  2  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  2  0
 13 15  1  0
  9 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
  4 21  1  0
M  CHG  2  18   1  20  -1
M  END

Alternative Forms

  1. Parent:

    ALA4572293

    ---

Associated Targets(Human)

FBP1 Tchem Fructose-1,6-bisphosphatase (1199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatocyte (2621 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 313.74Molecular Weight (Monoisotopic): 313.0717AlogP: 3.31#Rotatable Bonds: 6
Polar Surface Area: 78.67Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.57CX LogD: 3.57
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.46Np Likeness Score: -0.71

References

1. Huang Y, Wei L, Han X, Chen H, Ren Y, Xu Y, Song R, Rao L, Su C, Peng C, Feng L, Wan J..  (2019)  Discovery of novel allosteric site and covalent inhibitors of FBPase with potent hypoglycemic effects.,  184  [PMID:31589992] [10.1016/j.ejmech.2019.111749]

Source