Methyl-(S)-3-(4-(benzyloxy)phenyl)-2-(2-(1-(3-(m-tolyl)propanoyl)piperidin-4-yl)acetamido)propanoate

ID: ALA4572362

PubChem CID: 134355724

Max Phase: Preclinical

Molecular Formula: C34H40N2O5

Molecular Weight: 556.70

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CC1CCN(C(=O)CCc2cccc(C)c2)CC1

Standard InChI:  InChI=1S/C34H40N2O5/c1-25-7-6-10-26(21-25)13-16-33(38)36-19-17-28(18-20-36)23-32(37)35-31(34(39)40-2)22-27-11-14-30(15-12-27)41-24-29-8-4-3-5-9-29/h3-12,14-15,21,28,31H,13,16-20,22-24H2,1-2H3,(H,35,37)/t31-/m0/s1

Standard InChI Key:  BKPNGAWZVOYBDA-HKBQPEDESA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   32.1259  -15.7742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8394  -15.3634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5571  -15.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5571  -16.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8394  -17.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1259  -16.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2703  -17.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9835  -16.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9835  -15.7746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6967  -17.0148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4141  -16.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1272  -17.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8405  -16.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5578  -17.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1272  -17.8402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4141  -15.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1272  -15.3640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8409  -15.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5530  -15.3673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5562  -14.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8385  -14.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1217  -14.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2695  -14.1275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.9826  -14.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6959  -14.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4136  -14.5426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1215  -14.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1249  -13.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4112  -12.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6944  -13.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4128  -15.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4128  -14.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6954  -15.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9821  -15.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2689  -15.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5554  -15.3634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8432  -15.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8400  -16.5959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5535  -17.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2703  -16.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1313  -15.3562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  2  0
 11 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 17 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
  1 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 35 40  1  0
 37 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4572362

    ---

Associated Targets(Human)

NCI-H1650 (1118 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
YAP1 Tchem Transcriptional coactivator YAP1 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.70Molecular Weight (Monoisotopic): 556.2937AlogP: 5.04#Rotatable Bonds: 12
Polar Surface Area: 84.94Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.25CX Basic pKa: CX LogP: 5.30CX LogD: 5.30
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: -0.73

References

1.  (2018)  Yap1 inhibitors that target the interaction of yap1 with oct4, 

Source