The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl-(S)-3-(4-(benzyloxy)phenyl)-2-(2-(1-(3-(m-tolyl)propanoyl)piperidin-4-yl)acetamido)propanoate ID: ALA4572362
PubChem CID: 134355724
Max Phase: Preclinical
Molecular Formula: C34H40N2O5
Molecular Weight: 556.70
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CC1CCN(C(=O)CCc2cccc(C)c2)CC1
Standard InChI: InChI=1S/C34H40N2O5/c1-25-7-6-10-26(21-25)13-16-33(38)36-19-17-28(18-20-36)23-32(37)35-31(34(39)40-2)22-27-11-14-30(15-12-27)41-24-29-8-4-3-5-9-29/h3-12,14-15,21,28,31H,13,16-20,22-24H2,1-2H3,(H,35,37)/t31-/m0/s1
Standard InChI Key: BKPNGAWZVOYBDA-HKBQPEDESA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
32.1259 -15.7742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8394 -15.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5571 -15.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5571 -16.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8394 -17.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1259 -16.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2703 -17.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9835 -16.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9835 -15.7746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6967 -17.0148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4141 -16.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1272 -17.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8405 -16.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5578 -17.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1272 -17.8402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4141 -15.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1272 -15.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8409 -15.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5530 -15.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5562 -14.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8385 -14.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1217 -14.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2695 -14.1275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9826 -14.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6959 -14.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4136 -14.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1215 -14.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1249 -13.3059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4112 -12.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6944 -13.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4128 -15.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4128 -14.5382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6954 -15.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9821 -15.3636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2689 -15.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5554 -15.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8432 -15.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8400 -16.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5535 -17.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2703 -16.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1313 -15.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
11 16 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
17 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
25 30 1 0
1 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
35 40 1 0
37 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.70Molecular Weight (Monoisotopic): 556.2937AlogP: 5.04#Rotatable Bonds: 12Polar Surface Area: 84.94Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.25CX Basic pKa: ┄CX LogP: 5.30CX LogD: 5.30Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: -0.73
References 1. (2018) Yap1 inhibitors that target the interaction of yap1 with oct4,