4-(4-Methyl-5-(4-(piperazin-1-yl)phenyl)pyridin-3-yl)benzamide

ID: ALA4572458

PubChem CID: 155564435

Max Phase: Preclinical

Molecular Formula: C23H24N4O

Molecular Weight: 372.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(-c2ccc(C(N)=O)cc2)cncc1-c1ccc(N2CCNCC2)cc1

Standard InChI:  InChI=1S/C23H24N4O/c1-16-21(17-2-4-19(5-3-17)23(24)28)14-26-15-22(16)18-6-8-20(9-7-18)27-12-10-25-11-13-27/h2-9,14-15,25H,10-13H2,1H3,(H2,24,28)

Standard InChI Key:  IGTBPCFNGGLIBQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    2.6730   -4.1685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6719   -4.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3799   -5.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0937   -4.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0909   -4.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3781   -3.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3857   -6.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6722   -6.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6716   -7.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3798   -7.8623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0940   -7.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0911   -6.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3884   -8.6810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6752   -9.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6741   -9.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3846  -10.3227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0937   -9.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0964   -9.0906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8062   -5.3991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7981   -3.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5118   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5006   -2.5199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7937   -2.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2190   -2.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2219   -3.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9240   -2.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6344   -2.9164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9187   -1.6953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  4 19  1  0
 20 21  2  0
 21 25  1  0
 24 22  1  0
 22 23  2  0
 23 20  1  0
  5 20  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 26 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4572458

    ---

Associated Targets(Human)

TGFBR1 Tchem TGF-beta receptor type I (3786 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACVR1 Tchem Activin receptor type-1 (1516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.47Molecular Weight (Monoisotopic): 372.1950AlogP: 3.23#Rotatable Bonds: 4
Polar Surface Area: 71.25Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.88CX LogP: 2.99CX LogD: 1.50
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.74Np Likeness Score: -0.73

References

1. Ensan D, Smil D, Zepeda-Velázquez CA, Panagopoulos D, Wong JF, Williams EP, Adamson R, Bullock AN, Kiyota T, Aman A, Roberts OG, Edwards AM, O'Meara JA, Isaac MB, Al-Awar R..  (2020)  Targeting ALK2: An Open Science Approach to Developing Therapeutics for the Treatment of Diffuse Intrinsic Pontine Glioma.,  63  (9): [PMID:32369358] [10.1021/acs.jmedchem.0c00395]

Source