The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((5-chloro-2-((2-methoxy-4-(2-oxopiperidin-1-yl)phenyl)amino)pyrimidin-4-yl)amino)phenyl)acetamide ID: ALA4572661
PubChem CID: 155564024
Max Phase: Preclinical
Molecular Formula: C24H25ClN6O3
Molecular Weight: 480.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCCCC2=O)ccc1Nc1ncc(Cl)c(Nc2ccccc2NC(C)=O)n1
Standard InChI: InChI=1S/C24H25ClN6O3/c1-15(32)27-18-7-3-4-8-19(18)28-23-17(25)14-26-24(30-23)29-20-11-10-16(13-21(20)34-2)31-12-6-5-9-22(31)33/h3-4,7-8,10-11,13-14H,5-6,9,12H2,1-2H3,(H,27,32)(H2,26,28,29,30)
Standard InChI Key: POTGZPRTWMEZJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
16.7469 -9.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7457 -10.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4538 -10.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1634 -10.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1606 -9.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4520 -9.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4536 -11.6084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7458 -12.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7456 -12.8341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0382 -11.6081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8718 -10.7893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5789 -10.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2839 -10.7875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9905 -10.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9896 -9.5604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2763 -9.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5726 -9.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8623 -9.1605 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.6986 -10.7863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4059 -10.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1130 -10.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8198 -10.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8194 -9.5597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1063 -9.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4024 -9.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1128 -11.6036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8204 -12.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5261 -9.1494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2302 -9.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9348 -9.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9371 -8.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2286 -7.9251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5178 -8.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2291 -10.3757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
4 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
17 18 1 0
14 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
21 26 1 0
26 27 1 0
23 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
29 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.96Molecular Weight (Monoisotopic): 480.1677AlogP: 5.10#Rotatable Bonds: 7Polar Surface Area: 108.48Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.70CX Basic pKa: 3.19CX LogP: 3.66CX LogD: 3.66Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -1.56
References 1. Lei H, Jia F, Cao M, Wang J, Guo M, Zhu M, Zuo D, Zhai X.. (2019) An exploration of solvent-front region high affinity moiety leading to novel potent ALK & ROS1 dual inhibitors with mutant-combating effects., 27 (20): [PMID:31492532 ] [10.1016/j.bmc.2019.115051 ]