The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
serratamolide F ID: ALA457267
PubChem CID: 24862375
Max Phase: Preclinical
Molecular Formula: C25H44N2O8
Molecular Weight: 500.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Serratamolide F | CHEMBL457267
Canonical SMILES: CCCCCCC[C@@H]1CC(=O)N[C@@H](CO)C(=O)O[C@H](CCCCCC)CC(=O)N[C@@H](CO)C(=O)O1
Standard InChI: InChI=1S/C25H44N2O8/c1-3-5-7-9-11-13-19-15-23(31)27-20(16-28)24(32)34-18(12-10-8-6-4-2)14-22(30)26-21(17-29)25(33)35-19/h18-21,28-29H,3-17H2,1-2H3,(H,26,30)(H,27,31)/t18-,19-,20+,21+/m1/s1
Standard InChI Key: YSPXILNCISQEOY-CGXNFDGLSA-N
Molfile:
RDKit 2D
35 35 0 0 0 0 0 0 0 0999 V2000
10.2914 -5.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6055 -5.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0065 -5.4692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7478 -6.3522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9314 -6.2857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0019 -6.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7067 -6.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0447 -7.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7458 -7.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8235 -7.8364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0032 -7.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7549 -8.6494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1532 -8.5787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4756 -9.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3803 -8.0385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8430 -5.2252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3751 -6.0997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9181 -8.8877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2912 -6.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5730 -6.7038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4563 -7.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1747 -7.4215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0245 -9.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7392 -5.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4340 -5.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1667 -5.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8613 -5.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3272 -8.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5968 -8.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8994 -8.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1690 -8.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5940 -5.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2887 -5.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4717 -8.4787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7414 -8.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 1 0
7 17 2 0
2 4 1 0
13 18 2 0
3 5 1 0
6 19 1 6
4 6 1 0
19 20 1 0
5 7 1 0
9 21 1 6
6 8 1 0
21 22 1 0
7 9 1 0
12 23 1 1
8 10 1 0
3 24 1 1
9 11 1 0
24 25 1 0
12 10 1 0
25 26 1 0
11 13 1 0
26 27 1 0
12 14 1 0
23 28 1 0
13 14 1 0
28 29 1 0
29 30 1 0
8 15 2 0
30 31 1 0
1 2 1 0
31 34 1 0
2 16 2 0
27 32 1 0
32 33 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.63Molecular Weight (Monoisotopic): 500.3098AlogP: 1.89#Rotatable Bonds: 13Polar Surface Area: 151.26Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.58CX Basic pKa: ┄CX LogP: 2.43CX LogD: 2.43Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.22Np Likeness Score: 1.13
References 1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V.. (2008) Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp., 71 (4): [PMID:18303848 ] [10.1021/np7007126 ]