2-(1-((2-(3,4-Dimethoxyphenoxy)phenyl)amino)ethylidene)-5-phenylcyclohexane-1,3-dione

ID: ALA4572727

PubChem CID: 155563097

Max Phase: Preclinical

Molecular Formula: C28H27NO5

Molecular Weight: 457.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Oc2ccccc2NC(C)=C2C(=O)CC(c3ccccc3)CC2=O)cc1OC

Standard InChI:  InChI=1S/C28H27NO5/c1-18(28-23(30)15-20(16-24(28)31)19-9-5-4-6-10-19)29-22-11-7-8-12-25(22)34-21-13-14-26(32-2)27(17-21)33-3/h4-14,17,20,29H,15-16H2,1-3H3/b28-18-

Standard InChI Key:  JYHZXWRVJCHCBP-VEILYXNESA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   17.6315   -9.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6315  -10.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3368  -10.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0421  -10.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0421   -9.3894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3368   -8.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9226   -8.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9202   -8.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2161   -9.3936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3368   -8.1595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9244  -10.6163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7474  -10.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7448  -11.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4511  -11.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1604  -11.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1590  -10.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4521  -10.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5072   -8.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5088   -8.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8007   -7.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0932   -8.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0983   -8.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8069   -9.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8131  -10.2165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1085  -10.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4015  -10.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6974  -10.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7032  -11.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4190  -11.8586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1201  -11.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9992  -11.8706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2878  -11.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4281  -12.6758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7250  -13.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  2  0
  7  8  1  0
  7  9  1  0
  6 10  2  0
  2 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  4 12  1  0
  9 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 31 32  1  0
 29 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4572727

    ---

Associated Targets(Human)

CCRF-CEM (65223 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HMEC-1 (426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TUBB4B Tclin Tubulin (5180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

TUBB2B Tubulin (2175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.53Molecular Weight (Monoisotopic): 457.1889AlogP: 5.90#Rotatable Bonds: 7
Polar Surface Area: 73.86Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.74CX Basic pKa: CX LogP: 4.79CX LogD: 4.79
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.47

References

1. Bueno O, Gargantilla M, Estévez-Gallego J, Martins S, Díaz JF, Camarasa MJ, Liekens S, Pérez-Pérez MJ, Priego EM..  (2019)  Diphenyl ether derivatives occupy the expanded binding site of cyclohexanedione compounds at the colchicine site in tubulin by movement of the αT5 loop.,  171  [PMID:30921759] [10.1016/j.ejmech.2019.03.045]

Source