The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-((2-(3,4-Dimethoxyphenoxy)phenyl)amino)ethylidene)-5-phenylcyclohexane-1,3-dione ID: ALA4572727
PubChem CID: 155563097
Max Phase: Preclinical
Molecular Formula: C28H27NO5
Molecular Weight: 457.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Oc2ccccc2NC(C)=C2C(=O)CC(c3ccccc3)CC2=O)cc1OC
Standard InChI: InChI=1S/C28H27NO5/c1-18(28-23(30)15-20(16-24(28)31)19-9-5-4-6-10-19)29-22-11-7-8-12-25(22)34-21-13-14-26(32-2)27(17-21)33-3/h4-14,17,20,29H,15-16H2,1-3H3/b28-18-
Standard InChI Key: JYHZXWRVJCHCBP-VEILYXNESA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
17.6315 -9.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6315 -10.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3368 -10.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0421 -10.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0421 -9.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3368 -8.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9226 -8.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9202 -8.1657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2161 -9.3936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3368 -8.1595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9244 -10.6163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7474 -10.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7448 -11.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4511 -11.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1604 -11.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1590 -10.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4521 -10.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5072 -8.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5088 -8.1709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8007 -7.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0932 -8.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0983 -8.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8069 -9.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8131 -10.2165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1085 -10.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4015 -10.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6974 -10.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7032 -11.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4190 -11.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1201 -11.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9992 -11.8706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2878 -11.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4281 -12.6758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7250 -13.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 2 0
7 8 1 0
7 9 1 0
6 10 2 0
2 11 2 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
4 12 1 0
9 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
29 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.53Molecular Weight (Monoisotopic): 457.1889AlogP: 5.90#Rotatable Bonds: 7Polar Surface Area: 73.86Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.74CX Basic pKa: ┄CX LogP: 4.79CX LogD: 4.79Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.47
References 1. Bueno O, Gargantilla M, Estévez-Gallego J, Martins S, Díaz JF, Camarasa MJ, Liekens S, Pérez-Pérez MJ, Priego EM.. (2019) Diphenyl ether derivatives occupy the expanded binding site of cyclohexanedione compounds at the colchicine site in tubulin by movement of the αT5 loop., 171 [PMID:30921759 ] [10.1016/j.ejmech.2019.03.045 ]