The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(benzylsulfamoyl)-5-(4-chlorophenyl)-6-[2-(5-methoxypyrimidin-2-yl)oxyethoxy]-2-(4-pyridyl)pyrimidin-4-amine ID: ALA4572734
PubChem CID: 155563100
Max Phase: Preclinical
Molecular Formula: C29H26ClN7O5S
Molecular Weight: 620.09
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cnc(OCCOc2nc(-c3ccncc3)nc(NS(=O)(=O)NCc3ccccc3)c2-c2ccc(Cl)cc2)nc1
Standard InChI: InChI=1S/C29H26ClN7O5S/c1-40-24-18-32-29(33-19-24)42-16-15-41-28-25(21-7-9-23(30)10-8-21)27(35-26(36-28)22-11-13-31-14-12-22)37-43(38,39)34-17-20-5-3-2-4-6-20/h2-14,18-19,34H,15-17H2,1H3,(H,35,36,37)
Standard InChI Key: AQDCZLZCKZWUCZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
14.3875 -11.8245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8002 -12.5344 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.2087 -11.8220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8071 -14.1687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8059 -14.9883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5140 -15.3972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2236 -14.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2208 -14.1651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5122 -13.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5098 -12.9427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0943 -12.9469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9320 -15.3953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9333 -16.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6416 -16.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6429 -17.4372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3513 -17.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3845 -12.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6789 -12.9544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0998 -15.3966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3921 -14.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6846 -15.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6835 -16.2111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3959 -16.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1005 -16.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9723 -12.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2672 -12.9597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2711 -13.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9859 -14.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6880 -13.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9239 -13.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6335 -14.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3392 -13.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3365 -12.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6223 -12.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9195 -12.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0421 -12.5220 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.3482 -18.6603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0557 -19.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7637 -18.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7598 -17.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0517 -17.4328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4726 -19.0645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4750 -19.8817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 2 1 0
2 11 1 0
7 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
11 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
5 19 1 0
18 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 18 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
8 30 1 0
33 36 1 0
16 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 16 1 0
39 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.09Molecular Weight (Monoisotopic): 619.1405AlogP: 4.56#Rotatable Bonds: 13Polar Surface Area: 150.34Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.75CX Basic pKa: 3.61CX LogP: 4.51CX LogD: 4.37Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.18Np Likeness Score: -1.25
References 1. Boss C, Bolli MH, Gatfield J.. (2016) From bosentan (Tracleer®) to macitentan (Opsumit®): The medicinal chemistry perspective., 26 (15): [PMID:27321813 ] [10.1016/j.bmcl.2016.06.014 ]