The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(Diethylamino)ethyl)-2-oxo-1-phenethyl-1,2-dihydro-1,8-naphthyridine-3-carboxamide ID: ALA4572936
PubChem CID: 155563532
Max Phase: Preclinical
Molecular Formula: C23H28N4O2
Molecular Weight: 392.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1cc2cccnc2n(CCc2ccccc2)c1=O
Standard InChI: InChI=1S/C23H28N4O2/c1-3-26(4-2)16-14-25-22(28)20-17-19-11-8-13-24-21(19)27(23(20)29)15-12-18-9-6-5-7-10-18/h5-11,13,17H,3-4,12,14-16H2,1-2H3,(H,25,28)
Standard InChI Key: AVEIYXYJRJZJCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
13.1732 -26.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1742 -27.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8826 -27.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8806 -26.2460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5935 -26.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5938 -27.4793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3036 -27.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0176 -27.4788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0173 -26.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3030 -26.2439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7294 -26.2473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7290 -27.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7282 -28.7135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3016 -25.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0086 -25.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0072 -24.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7159 -23.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7148 -22.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0058 -22.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2965 -22.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3011 -23.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4375 -27.4850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1444 -27.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8520 -27.4885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5588 -27.8987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2674 -27.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9742 -27.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5570 -28.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2638 -29.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 4 1 0
2 3 1 0
3 6 2 0
5 4 2 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
8 12 1 0
12 13 2 0
10 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
12 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.50Molecular Weight (Monoisotopic): 392.2212AlogP: 2.71#Rotatable Bonds: 9Polar Surface Area: 67.23Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.04CX LogP: 2.59CX LogD: 0.94Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.52
References 1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG.. (2020) Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer., 63 (9): [PMID:32297747 ] [10.1021/acs.jmedchem.0c00161 ]