N-(2-(Diethylamino)ethyl)-2-oxo-1-phenethyl-1,2-dihydro-1,8-naphthyridine-3-carboxamide

ID: ALA4572936

PubChem CID: 155563532

Max Phase: Preclinical

Molecular Formula: C23H28N4O2

Molecular Weight: 392.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCNC(=O)c1cc2cccnc2n(CCc2ccccc2)c1=O

Standard InChI:  InChI=1S/C23H28N4O2/c1-3-26(4-2)16-14-25-22(28)20-17-19-11-8-13-24-21(19)27(23(20)29)15-12-18-9-6-5-7-10-18/h5-11,13,17H,3-4,12,14-16H2,1-2H3,(H,25,28)

Standard InChI Key:  AVEIYXYJRJZJCL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   13.1732  -26.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1742  -27.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8826  -27.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8806  -26.2460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5935  -26.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5938  -27.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3036  -27.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0176  -27.4788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0173  -26.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3030  -26.2439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7294  -26.2473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7290  -27.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7282  -28.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3016  -25.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0086  -25.0127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0072  -24.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7159  -23.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7148  -22.9735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0058  -22.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2965  -22.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3011  -23.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4375  -27.4850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1444  -27.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8520  -27.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5588  -27.8987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2674  -27.4916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9742  -27.9018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5570  -28.7159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2638  -29.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  4  1  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  8 12  1  0
 12 13  2  0
 10 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 12 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4572936

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.50Molecular Weight (Monoisotopic): 392.2212AlogP: 2.71#Rotatable Bonds: 9
Polar Surface Area: 67.23Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.04CX LogP: 2.59CX LogD: 0.94
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.52

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source