The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[4-[[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimidin-4-yl]amino]phenyl]benzamide ID: ALA4572941
PubChem CID: 134456941
Max Phase: Preclinical
Molecular Formula: C30H28N8O2
Molecular Weight: 532.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C/C=C/C(=O)Nc1ccc(C(=O)Nc2ccc(Nc3cc(-c4cnc5[nH]ccc5c4)ncn3)cc2)cc1
Standard InChI: InChI=1S/C30H28N8O2/c1-38(2)15-3-4-28(39)36-24-7-5-20(6-8-24)30(40)37-25-11-9-23(10-12-25)35-27-17-26(33-19-34-27)22-16-21-13-14-31-29(21)32-18-22/h3-14,16-19H,15H2,1-2H3,(H,31,32)(H,36,39)(H,37,40)(H,33,34,35)/b4-3+
Standard InChI Key: ZXIMCTYIDWUSCI-ONEGZZNKSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
18.0811 -18.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5994 -19.5817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8205 -19.3314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1145 -19.7381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4036 -19.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4036 -18.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1160 -18.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8205 -18.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5995 -18.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6955 -18.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9873 -18.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2790 -18.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2790 -17.2838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9849 -16.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6955 -17.2867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5668 -18.5151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8588 -18.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1547 -18.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4385 -18.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4385 -17.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1482 -16.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8588 -17.2897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7304 -16.8792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0223 -17.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3143 -16.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6060 -17.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8973 -16.8797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8973 -16.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6034 -15.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3143 -16.0547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1893 -15.6481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4771 -16.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7690 -15.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0609 -16.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3529 -15.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6448 -16.0599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9326 -15.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6448 -16.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4771 -16.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0223 -18.1063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
3 8 2 0
8 9 1 0
9 1 2 0
6 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
16 12 1 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
28 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
32 39 2 0
24 40 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.61Molecular Weight (Monoisotopic): 532.2335AlogP: 5.07#Rotatable Bonds: 9Polar Surface Area: 127.93Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.85CX Basic pKa: 8.81CX LogP: 4.27CX LogD: 2.85Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.20Np Likeness Score: -1.03
References 1. Manz TD, Sivakumaren SC, Yasgar A, Hall MD, Davis MI, Seo HS, Card JD, Ficarro SB, Shim H, Marto JA, Dhe-Paganon S, Sasaki AT, Boxer MB, Simeonov A, Cantley LC, Shen M, Zhang T, Ferguson FM, Gray NS.. (2020) Structure-Activity Relationship Study of Covalent Pan-phosphatidylinositol 5-Phosphate 4-Kinase Inhibitors., 11 (3): [PMID:32184968 ] [10.1021/acsmedchemlett.9b00402 ]