(R)-4-((3R,5R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-(2,2,2-trifluoroacetoxy)hexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid

ID: ALA4572967

PubChem CID: 101995091

Max Phase: Preclinical

Molecular Formula: C26H39F3O4

Molecular Weight: 472.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OC(=O)C(F)(F)F)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C26H39F3O4/c1-15(4-9-22(30)31)19-7-8-20-18-6-5-16-14-17(33-23(32)26(27,28)29)10-12-24(16,2)21(18)11-13-25(19,20)3/h15-21H,4-14H2,1-3H3,(H,30,31)/t15-,16-,17-,18+,19-,20+,21+,24+,25-/m1/s1

Standard InChI Key:  KMTDQGKWDQYXCL-BXVWHTCBSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    3.9209  -17.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9209  -17.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6261  -18.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6261  -16.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3314  -17.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3280  -17.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0300  -18.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7400  -17.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0370  -16.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7435  -17.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7604  -15.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0423  -15.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4670  -15.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4537  -16.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2282  -16.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7203  -16.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2497  -15.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2138  -18.3218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3200  -18.7252    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3241  -16.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4620  -15.0644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2421  -14.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9459  -14.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6574  -14.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3613  -14.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0728  -14.7985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3536  -13.5794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5306  -14.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9520  -15.2295    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4455  -17.5201    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0299  -17.5036    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7356  -16.2860    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5055  -17.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7983  -18.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5043  -17.0970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0900  -17.9163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.7995  -19.1410    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0855  -18.7252    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  2 18  1  6
  6 19  1  1
  5 20  1  1
 13 21  1  1
 17 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 22 28  1  6
 17 29  1  6
 14 30  1  6
  9 31  1  6
 10 32  1  1
 18 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
 34 37  1  0
 34 38  1  0
M  END

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.2800AlogP: 6.62#Rotatable Bonds: 5
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.79CX Basic pKa: CX LogP: 6.60CX LogD: 4.03
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: 1.78

References

1. Masuno H, Kazui Y, Tanatani A, Fujii S, Kawachi E, Ikura T, Ito N, Yamamoto K, Kagechika H..  (2019)  Development of novel lithocholic acid derivatives as vitamin D receptor agonists.,  27  (16): [PMID:31300316] [10.1016/j.bmc.2019.07.003]

Source