The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-(4-(cyclopropylmethyl)piperazin-1-yl)-3-(trifluoromethyl)phenylamino)-6-ethyl-5-(trans-4-hydroxycyclohexylamino)pyrazine-2-carboxamide ID: ALA4572977
PubChem CID: 66643665
Max Phase: Preclinical
Molecular Formula: C28H38F3N7O2
Molecular Weight: 561.65
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc(C(N)=O)c(Nc2ccc(N3CCN(CC4CC4)CC3)c(C(F)(F)F)c2)nc1N[C@H]1CC[C@H](O)CC1
Standard InChI: InChI=1S/C28H38F3N7O2/c1-2-22-26(33-18-5-8-20(39)9-6-18)36-27(24(35-22)25(32)40)34-19-7-10-23(21(15-19)28(29,30)31)38-13-11-37(12-14-38)16-17-3-4-17/h7,10,15,17-18,20,39H,2-6,8-9,11-14,16H2,1H3,(H2,32,40)(H2,33,34,36)/t18-,20-
Standard InChI Key: IFHYNTCELNSYBE-KESTWPANSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
15.5095 -10.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1832 -10.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5331 -11.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0022 -10.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5216 -3.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5206 -7.5820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8067 -7.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8032 -8.8098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5148 -9.2271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2313 -8.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2364 -7.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2330 -3.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9474 -2.6233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6621 -3.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6621 -3.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9500 -4.2748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2330 -3.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5186 -4.2771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5186 -5.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2329 -5.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8067 -6.3438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7998 -5.5178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3765 -4.2759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0909 -3.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0909 -3.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8095 -2.6224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5239 -3.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8095 -4.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3765 -2.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3765 -1.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5186 -2.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8042 -3.0384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5186 -1.7961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2318 -6.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5204 -6.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0939 -6.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2356 -2.6233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3785 -6.3484 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0964 -7.5830 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.3757 -7.1625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
2 4 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
12 17 1 0
17 18 1 0
18 19 1 0
20 19 2 0
34 20 1 0
21 35 1 0
22 21 2 0
19 22 1 0
15 23 1 0
24 23 1 1
25 24 1 0
26 25 1 0
5 26 1 0
27 5 1 0
28 27 1 0
24 28 1 0
14 29 1 0
29 30 1 0
12 31 1 0
31 32 2 0
31 33 1 0
34 35 2 0
35 6 1 0
21 36 1 0
5 37 1 6
36 38 1 0
36 39 1 0
36 40 1 0
9 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.65Molecular Weight (Monoisotopic): 561.3039AlogP: 4.15#Rotatable Bonds: 9Polar Surface Area: 119.64Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.39CX LogP: 5.03CX LogD: 4.00Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.36Np Likeness Score: -1.15
References 1. (2016) Diamino heterocyclic carboxamide compound,