The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((1R,2R,3S,4R)-4-((5-(5-fluoro-1-(naphthalen-2-ylmethyl)-1H-indole-3-carbonyl)pyridine-4-yl)amino)-2,3-dihydroxycyclopentyl)methyl sulfamate ID: ALA4573093
PubChem CID: 155553982
Max Phase: Preclinical
Molecular Formula: C30H28FN5O6S
Molecular Weight: 605.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2cn(Cc3ccc4ccccc4c3)c3ccc(F)cc23)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C30H28FN5O6S/c31-21-7-8-26-22(11-21)24(14-36(26)13-17-5-6-18-3-1-2-4-19(18)9-17)28(38)23-12-33-16-34-30(23)35-25-10-20(27(37)29(25)39)15-42-43(32,40)41/h1-9,11-12,14,16,20,25,27,29,37,39H,10,13,15H2,(H2,32,40,41)(H,33,34,35)/t20-,25-,27-,29+/m1/s1
Standard InChI Key: IFIIGJXRDOYWOO-NOFZIXGYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
3.7733 -17.4537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4906 -17.8664 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.4894 -17.0390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7120 -17.3119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3679 -19.0059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2506 -17.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3108 -17.9686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9294 -17.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6856 -18.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8528 -18.3411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5854 -17.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8075 -17.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3276 -17.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1564 -18.6668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7711 -19.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5563 -18.9588 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7233 -18.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1072 -17.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2716 -16.7905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0545 -16.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6532 -16.2437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1246 -15.7362 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2991 -15.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3868 -16.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7231 -17.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8162 -17.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5727 -18.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2366 -17.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1400 -16.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6039 -15.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4256 -15.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9951 -18.5284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1736 -19.0069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7651 -15.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5861 -15.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8994 -14.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6676 -18.9760 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7164 -14.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0648 -15.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8885 -15.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3646 -14.6915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0112 -13.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1885 -13.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
11 6 1 0
11 10 1 0
6 8 1 0
10 9 1 0
8 9 1 0
11 12 1 1
12 7 1 0
8 4 1 1
10 5 1 6
4 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 25 1 0
24 22 1 0
22 23 1 0
23 20 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
22 30 1 0
30 31 1 0
7 2 1 0
2 32 1 0
9 33 1 6
31 34 2 0
34 35 1 0
35 39 2 0
38 36 2 0
36 31 1 0
27 37 1 0
38 39 1 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.65Molecular Weight (Monoisotopic): 605.1744AlogP: 2.75#Rotatable Bonds: 9Polar Surface Area: 169.66Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.39CX Basic pKa: 4.16CX LogP: 3.06CX LogD: 3.06Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.18Np Likeness Score: -0.61
References 1. (2017) Novel heterocyclic compound, method for preparing same, and pharmaceutical composition comprising same as active ingredient for preventing or treating cancer,