The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((1R,2R,3S,4R)-4-((5-(5-fluoro-1-(4-(pentafluoro-lambda6-sulfanyl)benzyl)-1H-indole-3-carbonyl)pyrimidin-4-yl)amino)-2,3-dihydroxycyclopentyl)methyl sulfamate ID: ALA4573232
PubChem CID: 155563353
Max Phase: Preclinical
Molecular Formula: C26H25F6N5O6S2
Molecular Weight: 681.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2cn(Cc3ccc(S(F)(F)(F)(F)F)cc3)c3ccc(F)cc23)[C@H](O)[C@@H]1O
Standard InChI: InChI=1S/C26H25F6N5O6S2/c27-16-3-6-22-18(8-16)20(11-37(22)10-14-1-4-17(5-2-14)45(28,29,30,31)32)24(39)19-9-34-13-35-26(19)36-21-7-15(23(38)25(21)40)12-43-44(33,41)42/h1-6,8-9,11,13,15,21,23,25,38,40H,7,10,12H2,(H2,33,41,42)(H,34,35,36)/t15-,21-,23-,25+/m1/s1
Standard InChI Key: HKSXLMUAZXOPJU-KSZWDZKGSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
3.7739 -17.4561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4912 -17.8690 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.4901 -17.0414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7132 -17.3143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3688 -19.0086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2516 -17.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3115 -17.9710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9306 -17.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6867 -18.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8538 -18.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5863 -17.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8083 -17.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3288 -17.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1577 -18.6694 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7725 -19.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5578 -18.9615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7248 -18.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1087 -17.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2731 -16.7929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0560 -16.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6545 -16.2460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1263 -15.7385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3007 -15.7459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3886 -16.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7247 -17.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8178 -17.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5744 -18.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2385 -17.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1419 -16.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6056 -15.0660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4275 -15.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9956 -18.5310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1747 -19.0096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7670 -15.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5881 -15.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9013 -14.4720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6693 -18.9787 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7214 -14.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0669 -15.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8890 -15.3750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.2340 -16.1251 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.8840 -14.5454 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.7138 -15.3711 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.4711 -16.0841 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.4720 -14.7830 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
11 6 1 0
11 10 1 0
6 8 1 0
10 9 1 0
8 9 1 0
11 12 1 1
12 7 1 0
8 4 1 1
10 5 1 6
4 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 25 1 0
24 22 1 0
22 23 1 0
23 20 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
22 30 1 0
30 31 1 0
7 2 1 0
2 32 1 0
9 33 1 6
31 34 2 0
34 35 1 0
35 39 2 0
38 36 2 0
36 31 1 0
27 37 1 0
38 39 1 0
39 40 1 0
40 41 1 0
40 42 1 0
40 43 1 0
40 44 1 0
40 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 681.64Molecular Weight (Monoisotopic): 681.1150AlogP: 4.25#Rotatable Bonds: 10Polar Surface Area: 169.66Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.39CX Basic pKa: 4.16CX LogP: 3.98CX LogD: 3.98Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.14Np Likeness Score: -0.51
References 1. (2017) Novel heterocyclic compound, method for preparing same, and pharmaceutical composition comprising same as active ingredient for preventing or treating cancer,