The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
diethyl 2,6-dimethyl-4-(4-(5-(piperidin-1-yl)pentyloxy)phenyl)-1,4-dihydropyridine-3,5-dicarboxylate ID: ALA4573309
PubChem CID: 155563181
Max Phase: Preclinical
Molecular Formula: C29H42N2O5
Molecular Weight: 498.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccc(OCCCCCN2CCCCC2)cc1
Standard InChI: InChI=1S/C29H42N2O5/c1-5-34-28(32)25-21(3)30-22(4)26(29(33)35-6-2)27(25)23-13-15-24(16-14-23)36-20-12-8-11-19-31-17-9-7-10-18-31/h13-16,27,30H,5-12,17-20H2,1-4H3
Standard InChI Key: LEFLUEYSKFGASD-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
9.9953 -8.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9961 -7.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7046 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4122 -7.4344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4114 -8.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7029 -8.6600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2905 -7.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2914 -6.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5821 -7.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1243 -7.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8319 -7.4362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1251 -6.2067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7075 -6.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9999 -5.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0028 -4.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7148 -4.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4204 -4.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4195 -5.7991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7156 -3.7548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0080 -3.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2960 -3.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5883 -3.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8799 -3.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1743 -3.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1751 -2.5232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1190 -8.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2868 -8.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8744 -7.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8773 -6.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8336 -5.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5412 -6.2105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8897 -2.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8925 -1.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1860 -0.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4750 -1.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4705 -2.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
2 7 1 0
10 11 2 0
10 12 1 0
4 10 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
19 20 1 0
16 19 1 0
3 13 1 0
5 26 1 0
1 27 1 0
28 29 1 0
9 28 1 0
30 31 1 0
12 30 1 0
25 32 1 0
25 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.66Molecular Weight (Monoisotopic): 498.3094AlogP: 5.08#Rotatable Bonds: 12Polar Surface Area: 77.10Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.82CX LogP: 4.32CX LogD: 1.94Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -0.74
References 1. Malek R, Arribas RL, Palomino-Antolin A, Totoson P, Demougeot C, Kobrlova T, Soukup O, Iriepa I, Moraleda I, Diez-Iriepa D, Godyń J, Panek D, Malawska B, Głuch-Lutwin M, Mordyl B, Siwek A, Chabchoub F, Marco-Contelles J, Kiec-Kononowicz K, Egea J, de Los Ríos C, Ismaili L.. (2019) New Dual Small Molecules for Alzheimer's Disease Therapy Combining Histamine H3 Receptor (H3R) Antagonism and Calcium Channels Blockade with Additional Cholinesterase Inhibition., 62 (24): [PMID:31724859 ] [10.1021/acs.jmedchem.9b00937 ]