The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-(6-Fluoropyridin-3-yl)-1-(3-(trifluoromethyl)phenyl)benzo[h][1,6]naphthyridin-2(1H)-one ID: ALA4573610
PubChem CID: 155249549
Max Phase: Preclinical
Molecular Formula: C24H13F4N3O
Molecular Weight: 435.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1ccc2cnc3ccc(-c4ccc(F)nc4)cc3c2n1-c1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C24H13F4N3O/c25-21-8-5-15(12-30-21)14-4-7-20-19(10-14)23-16(13-29-20)6-9-22(32)31(23)18-3-1-2-17(11-18)24(26,27)28/h1-13H
Standard InChI Key: BSRLVGYKEGTVAE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
16.5364 -16.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5352 -16.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2433 -17.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2415 -15.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9501 -16.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9509 -16.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6594 -17.2320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3677 -16.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8307 -15.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8318 -14.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1248 -14.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4162 -14.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4191 -15.6048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1266 -16.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9380 -14.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9372 -13.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2281 -13.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5217 -13.5620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5290 -14.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2387 -14.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2238 -12.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9294 -11.9199 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.5140 -11.9272 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.2188 -11.5108 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.6492 -15.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3595 -15.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0626 -15.5879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0615 -14.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3512 -14.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6419 -14.7754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3487 -13.5468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7079 -14.3759 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 26 1 0
25 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 9 1 0
30 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
17 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
25 26 2 0
25 30 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
12 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.38Molecular Weight (Monoisotopic): 435.0995AlogP: 5.76#Rotatable Bonds: 2Polar Surface Area: 47.78Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.43CX LogP: 5.12CX LogD: 5.12Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.20Np Likeness Score: -1.19
References 1. Hao T, Li Y, Fan S, Li W, Wang S, Li S, Cao R, Zhong W.. (2019) Design, synthesis and pharmacological evaluation of a novel mTOR-targeted anti-EV71 agent., 175 [PMID:31082764 ] [10.1016/j.ejmech.2019.04.048 ]