The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium 2-(1-benzyl-3-(4-methoxyphenyl)-1H-indol-2-yl)-2-tert-butoxyacetate ID: ALA4573753
PubChem CID: 155563548
Max Phase: Preclinical
Molecular Formula: C28H28NNaO4
Molecular Weight: 443.54
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2c(C(OC(C)(C)C)C(=O)[O-])n(Cc3ccccc3)c3ccccc23)cc1.[Na+]
Standard InChI: InChI=1S/C28H29NO4.Na/c1-28(2,3)33-26(27(30)31)25-24(20-14-16-21(32-4)17-15-20)22-12-8-9-13-23(22)29(25)18-19-10-6-5-7-11-19;/h5-17,26H,18H2,1-4H3,(H,30,31);/q;+1/p-1
Standard InChI Key: BZAAGQWQUSEFHI-UHFFFAOYSA-M
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
16.3513 -5.4363 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
12.9849 -5.0064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4728 -4.3410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9881 -3.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2009 -4.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2047 -3.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4917 -3.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7743 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7744 -4.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4881 -5.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2978 -4.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7079 -5.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7128 -3.6309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5377 -3.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9528 -2.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9478 -4.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3622 -3.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2929 -5.7729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5328 -5.0626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2373 -5.7918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6834 -6.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8797 -6.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3259 -6.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5782 -7.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3893 -7.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9395 -7.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2449 -2.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0507 -2.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3076 -1.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7567 -1.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9457 -1.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6927 -2.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0124 -0.5388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8198 -0.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
11 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
12 18 2 0
12 19 1 0
2 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
4 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
M CHG 2 1 1 19 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.54Molecular Weight (Monoisotopic): 443.2097AlogP: 6.31#Rotatable Bonds: 7Polar Surface Area: 60.69Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.04CX Basic pKa: ┄CX LogP: 6.05CX LogD: 2.92Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.40
References 1. Patel PA, Kvaratskhelia N, Mansour Y, Antwi J, Feng L, Koneru P, Kobe MJ, Jena N, Shi G, Mohamed MS, Li C, Kessl JJ, Fuchs JR.. (2016) Indole-based allosteric inhibitors of HIV-1 integrase., 26 (19): [PMID:27568085 ] [10.1016/j.bmcl.2016.08.037 ]