sodium 2-(1-benzyl-3-(4-methoxyphenyl)-1H-indol-2-yl)-2-tert-butoxyacetate

ID: ALA4573753

PubChem CID: 155563548

Max Phase: Preclinical

Molecular Formula: C28H28NNaO4

Molecular Weight: 443.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2c(C(OC(C)(C)C)C(=O)[O-])n(Cc3ccccc3)c3ccccc23)cc1.[Na+]

Standard InChI:  InChI=1S/C28H29NO4.Na/c1-28(2,3)33-26(27(30)31)25-24(20-14-16-21(32-4)17-15-20)22-12-8-9-13-23(22)29(25)18-19-10-6-5-7-11-19;/h5-17,26H,18H2,1-4H3,(H,30,31);/q;+1/p-1

Standard InChI Key:  BZAAGQWQUSEFHI-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
   16.3513   -5.4363    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
   12.9849   -5.0064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4728   -4.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9881   -3.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2009   -4.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2047   -3.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4917   -3.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7743   -3.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7744   -4.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4881   -5.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2978   -4.3440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7079   -5.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7128   -3.6309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5377   -3.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9528   -2.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9478   -4.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3622   -3.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2929   -5.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5328   -5.0626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2373   -5.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6834   -6.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8797   -6.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3259   -6.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5782   -7.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3893   -7.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9395   -7.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2449   -2.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0507   -2.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3076   -1.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7567   -1.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9457   -1.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6927   -2.2766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0124   -0.5388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8198   -0.3689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 12 18  2  0
 12 19  1  0
  2 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  4 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 33 34  1  0
M  CHG  2   1   1  19  -1
M  END

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 integrase (9041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.54Molecular Weight (Monoisotopic): 443.2097AlogP: 6.31#Rotatable Bonds: 7
Polar Surface Area: 60.69Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.04CX Basic pKa: CX LogP: 6.05CX LogD: 2.92
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.40

References

1. Patel PA, Kvaratskhelia N, Mansour Y, Antwi J, Feng L, Koneru P, Kobe MJ, Jena N, Shi G, Mohamed MS, Li C, Kessl JJ, Fuchs JR..  (2016)  Indole-based allosteric inhibitors of HIV-1 integrase.,  26  (19): [PMID:27568085] [10.1016/j.bmcl.2016.08.037]

Source