The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(2-chloro-5-methoxyphenoxy)-6-(2-(5-(methylsulfonyl)pyrimidin-2-yloxy)ethoxy)pyrimidin-4-yl)methanesulfonamide ID: ALA4574034
PubChem CID: 155564169
Max Phase: Preclinical
Molecular Formula: C19H20ClN5O8S2
Molecular Weight: 545.98
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cl)c(Oc2c(NS(C)(=O)=O)ncnc2OCCOc2ncc(S(C)(=O)=O)cn2)c1
Standard InChI: InChI=1S/C19H20ClN5O8S2/c1-30-12-4-5-14(20)15(8-12)33-16-17(25-35(3,28)29)23-11-24-18(16)31-6-7-32-19-21-9-13(10-22-19)34(2,26)27/h4-5,8-11H,6-7H2,1-3H3,(H,23,24,25)
Standard InChI Key: ZQMGLMDAJMDRHF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
8.7951 -19.6497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3907 -18.9440 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9817 -19.6471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3071 -11.7048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7198 -12.4147 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1283 -11.7023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7267 -14.0490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7255 -14.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4336 -15.2775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1432 -14.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1404 -14.0454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4318 -13.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8466 -13.6342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5558 -14.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5556 -14.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2640 -15.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9711 -14.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9654 -14.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2564 -13.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4294 -12.8230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0139 -12.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8516 -15.2756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8529 -16.0928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5612 -16.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5625 -17.3175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2709 -17.7249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2667 -16.0780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9757 -16.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2491 -12.8088 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2678 -18.5406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9753 -18.9480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6833 -18.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6794 -17.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9713 -17.3131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0988 -18.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 1 0
20 5 1 0
5 21 1 0
10 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
16 27 1 0
27 28 1 0
19 29 1 0
26 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 26 1 0
32 2 1 0
2 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.98Molecular Weight (Monoisotopic): 545.0442AlogP: 1.95#Rotatable Bonds: 11Polar Surface Area: 168.79Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.51CX Basic pKa: 3.26CX LogP: 0.64CX LogD: -0.03Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.16
References 1. Boss C, Bolli MH, Gatfield J.. (2016) From bosentan (Tracleer®) to macitentan (Opsumit®): The medicinal chemistry perspective., 26 (15): [PMID:27321813 ] [10.1016/j.bmcl.2016.06.014 ]