The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-epi-Ophiobolin J ID: ALA4574086
PubChem CID: 101419604
Max Phase: Preclinical
Molecular Formula: C25H36O4
Molecular Weight: 400.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=C[C@H]1C[C@H](C)[C@]2(CC[C@]3(C)C[C@@H]4C(C)=CC(=O)/C4=C(\CO)[C@H](O)C[C@H]32)O1
Standard InChI: InChI=1S/C25H36O4/c1-14(2)8-17-10-16(4)25(29-17)7-6-24(5)12-18-15(3)9-21(28)23(18)19(13-26)20(27)11-22(24)25/h8-9,16-18,20,22,26-27H,6-7,10-13H2,1-5H3/b23-19+/t16-,17-,18+,20+,22+,24+,25-/m0/s1
Standard InChI Key: LFYREHKMIHWZQF-VNBBXFQNSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
18.4696 -3.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2579 -2.9127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2974 -2.0966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5334 -1.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0219 -2.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7159 -3.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2951 -2.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1148 -4.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1148 -2.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6899 -3.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6890 -4.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4676 -4.4538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9497 -3.7918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9610 -3.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3126 -3.5657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2952 -4.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7160 -4.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9889 -4.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1187 -5.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9260 -5.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2989 -6.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2598 -4.2031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6810 -5.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8721 -5.3530 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.2057 -2.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9810 -1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2671 -3.9580 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.7106 -2.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3942 -1.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7566 -2.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9824 -2.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 6
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
17 6 2 0
6 7 1 0
16 8 1 0
8 11 1 0
10 9 1 0
9 7 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 1 1 0
1 10 1 0
6 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 16 1 0
20 21 1 0
18 22 2 0
11 23 1 1
16 24 1 1
5 25 1 1
3 26 1 6
10 27 1 6
26 28 2 0
28 29 1 0
28 30 1 0
7 31 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.56Molecular Weight (Monoisotopic): 400.2614AlogP: 4.12#Rotatable Bonds: 2Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.32CX LogD: 3.32Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: 2.87
References 1. Liu M, Sun W, Shen L, Hao X, Al Anbari WH, Lin S, Li H, Gao W, Wang J, Hu Z, Zhang Y.. (2019) Bipolaricins A-I, Ophiobolin-Type Tetracyclic Sesterterpenes from a Phytopathogenic Bipolaris sp. Fungus., 82 (10): [PMID:31573805 ] [10.1021/acs.jnatprod.9b00744 ]