The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-{[(5-Chloro-8-hydroxyquinolin-7-yl)methyl]amino}-N-[2-(2-methyl-1H-indol-3-yl)ethyl]butanamide ID: ALA4574404
PubChem CID: 155563771
Max Phase: Preclinical
Molecular Formula: C25H27ClN4O2
Molecular Weight: 450.97
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c2ccccc2c1CCNC(=O)CCCNCc1cc(Cl)c2cccnc2c1O
Standard InChI: InChI=1S/C25H27ClN4O2/c1-16-18(19-6-2-3-8-22(19)30-16)10-13-28-23(31)9-5-11-27-15-17-14-21(26)20-7-4-12-29-24(20)25(17)32/h2-4,6-8,12,14,27,30,32H,5,9-11,13,15H2,1H3,(H,28,31)
Standard InChI Key: WPNHTKMCALCYSY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
33.6231 -13.8179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6220 -14.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3300 -15.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3282 -13.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0368 -13.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0376 -14.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7461 -15.0404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4544 -14.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4497 -13.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7406 -13.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3319 -15.8636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3258 -12.5919 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.9139 -15.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2066 -14.6363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4985 -15.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7911 -14.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0831 -15.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3757 -14.6341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6677 -15.0421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3764 -13.8169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9603 -14.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9610 -13.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2536 -13.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9591 -13.1326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5055 -13.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3682 -12.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1662 -12.5959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7110 -11.9909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4592 -11.2150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6573 -11.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1160 -11.6538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3355 -14.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
4 12 1 0
2 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 27 1 0
26 24 1 0
24 25 1 0
25 23 2 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.97Molecular Weight (Monoisotopic): 450.1823AlogP: 4.61#Rotatable Bonds: 9Polar Surface Area: 90.04Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.10CX Basic pKa: 10.24CX LogP: 2.65CX LogD: 2.50Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.28Np Likeness Score: -0.86
References 1. Chen C, Yang X, Fang H, Hou X.. (2019) Design, synthesis and preliminary bioactivity evaluations of 8-hydroxyquinoline derivatives as matrix metalloproteinase (MMP) inhibitors., 181 [PMID:31415980 ] [10.1016/j.ejmech.2019.111563 ]