(1R,3S)-3-(6-Dimethylamino-hexanoylamino)-cyclopentanecarboxylic acid N-(4-benzooxazol-2-yl-phenyl)-N-methylamide

ID: ALA4574471

PubChem CID: 155564543

Max Phase: Preclinical

Molecular Formula: C28H37N5O3

Molecular Weight: 491.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCCCCNC(=O)N[C@H]1CC[C@@H](C(=O)N(C)c2ccc(-c3nc4ccccc4o3)cc2)C1

Standard InChI:  InChI=1S/C28H37N5O3/c1-32(2)18-8-4-7-17-29-28(35)30-22-14-11-21(19-22)27(34)33(3)23-15-12-20(13-16-23)26-31-24-9-5-6-10-25(24)36-26/h5-6,9-10,12-13,15-16,21-22H,4,7-8,11,14,17-19H2,1-3H3,(H2,29,30,35)/t21-,22+/m1/s1

Standard InChI Key:  NQMSCMXZUAGEGE-YADHBBJMSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    3.5521  -11.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5510  -11.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2590  -12.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9687  -11.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9659  -11.1234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2572  -10.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6720  -10.7121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3813  -11.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6689   -9.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3843  -11.9352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0874  -10.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8327  -11.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3772  -10.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9659   -9.7237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1673   -9.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2954   -8.9759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1078   -8.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5907   -9.5466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4373   -8.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4031   -9.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8859  -10.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8415  -12.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0952  -12.0230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7554  -13.1686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9560  -13.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5515  -12.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385  -12.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3290  -13.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385  -14.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5501  -14.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6983  -10.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1812  -10.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9936  -10.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4764  -11.2588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2888  -11.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1469  -12.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  8 10  2  0
 11  8  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 14 16  1  1
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  1  0
 22 23  1  0
 23 26  1  0
 25 24  1  0
 24 22  2  0
  2 22  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 21 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4574471

    ---

Associated Targets(Human)

FASN Tchem Fatty acid synthase (3390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.64Molecular Weight (Monoisotopic): 491.2896AlogP: 4.66#Rotatable Bonds: 10
Polar Surface Area: 90.71Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.79CX LogP: 3.37CX LogD: 1.01
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.43

References

1.  (2017)  Cyclopentanecarboxamide derivatives, medicaments containing such compounds and their use, 

Source