The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((1-(3-fluoro-4-(trifluoromethoxy)phenethyl)pyrrolidin-3-yl)methyl)-3-isopropylisoxazole-5-carboxamide ID: ALA4574825
PubChem CID: 153635907
Max Phase: Preclinical
Molecular Formula: C21H25F4N3O3
Molecular Weight: 443.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc(C(=O)NC[C@H]2CCN(CCc3ccc(OC(F)(F)F)c(F)c3)C2)on1
Standard InChI: InChI=1S/C21H25F4N3O3/c1-13(2)17-10-19(31-27-17)20(29)26-11-15-6-8-28(12-15)7-5-14-3-4-18(16(22)9-14)30-21(23,24)25/h3-4,9-10,13,15H,5-8,11-12H2,1-2H3,(H,26,29)/t15-/m1/s1
Standard InChI Key: PCJXDEBLVOSOBD-OAHLLOKOSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
40.8183 -8.3081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.6354 -8.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8898 -7.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2269 -7.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5681 -7.5314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6674 -7.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2739 -7.8276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.0514 -7.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6580 -8.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2225 -6.7771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3371 -8.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5245 -8.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0433 -9.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2304 -9.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7494 -10.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0807 -10.8613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8978 -10.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3752 -10.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9368 -10.0265 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.6004 -11.5225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9328 -12.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4525 -12.9301 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.7455 -12.3544 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.3337 -12.9719 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.5732 -8.9351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.3193 -9.2685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.8669 -8.6619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4592 -7.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6795 -8.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.0110 -9.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.1607 -8.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 1 6
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
1 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
15 19 1 0
16 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
9 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 9 2 0
27 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.44Molecular Weight (Monoisotopic): 443.1832AlogP: 4.13#Rotatable Bonds: 8Polar Surface Area: 67.60Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.45CX Basic pKa: 8.40CX LogP: 4.38CX LogD: 3.34Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.62Np Likeness Score: -1.78
References 1. Son WS, Jeong KS, Lim SM, Pae AN.. (2019) Structural hybridization of pyrrolidine-based T-type calcium channel inhibitors and exploration of their analgesic effects in a neuropathic pain model., 29 (10): [PMID:30928197 ] [10.1016/j.bmcl.2019.03.026 ]