3-(4-(2-chlorophenyl)-6-(thiophen-3-yl)pyridin-2-yl)phenol

ID: ALA4575112

PubChem CID: 155560846

Max Phase: Preclinical

Molecular Formula: C21H14ClNOS

Molecular Weight: 363.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1cccc(-c2cc(-c3ccccc3Cl)cc(-c3ccsc3)n2)c1

Standard InChI:  InChI=1S/C21H14ClNOS/c22-19-7-2-1-6-18(19)16-11-20(14-4-3-5-17(24)10-14)23-21(12-16)15-8-9-25-13-15/h1-13,24H

Standard InChI Key:  OFGVLGKYYVUVSZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   39.7066   -5.1095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7055   -5.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4135   -6.3380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1232   -5.9285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1204   -5.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4118   -4.7006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4065   -3.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1146   -3.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1125   -2.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4031   -2.2524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6942   -2.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6998   -3.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9994   -6.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2917   -5.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5842   -6.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5831   -7.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2954   -7.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0001   -7.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2977   -8.3781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.8231   -3.8834    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   41.8316   -6.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9188   -7.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7184   -7.3148    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.1259   -6.6064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5781   -6.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  6  7  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 13  1  0
 17 19  1  0
  8 20  1  0
  4 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4575112

    ---

Associated Targets(Human)

T47D (39041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 363.87Molecular Weight (Monoisotopic): 363.0485AlogP: 6.50#Rotatable Bonds: 3
Polar Surface Area: 33.12Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.62CX Basic pKa: 3.08CX LogP: 6.55CX LogD: 6.55
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.45Np Likeness Score: -1.15

References

1. Liang X, Wu Q, Luan S, Yin Z, He C, Yin L, Zou Y, Yuan Z, Li L, Song X, He M, Lv C, Zhang W..  (2019)  A comprehensive review of topoisomerase inhibitors as anticancer agents in the past decade.,  171  [PMID:30917303] [10.1016/j.ejmech.2019.03.034]

Source