Brachangobinan K

ID: ALA4575213

PubChem CID: 155551746

Max Phase: Preclinical

Molecular Formula: C23H26O8

Molecular Weight: 430.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)[C@@H](COC(=O)CC(C)C)c2cc(C=O)cc(OC)c2O)ccc1O

Standard InChI:  InChI=1S/C23H26O8/c1-13(2)7-21(26)31-12-17(16-8-14(11-24)9-20(30-4)23(16)28)22(27)15-5-6-18(25)19(10-15)29-3/h5-6,8-11,13,17,25,28H,7,12H2,1-4H3/t17-/m0/s1

Standard InChI Key:  UPBQHHRBDWWYCJ-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
    6.9612   -5.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9601   -5.8671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6681   -6.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3778   -5.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3749   -5.0440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6663   -4.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0811   -4.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0780   -3.8155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6679   -7.0933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9601   -7.5017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2520   -6.2751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2534   -4.6391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2532   -3.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5458   -5.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8380   -4.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5460   -5.8651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9608   -3.4132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8414   -3.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1345   -3.4133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4259   -3.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4287   -4.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1362   -5.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7175   -3.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1347   -2.5961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8425   -2.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9606   -2.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6682   -2.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2528   -2.1876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6680   -1.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3757   -0.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9602   -0.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  3  9  1  0
  9 10  1  0
  2 11  1  0
  1 12  1  0
 12 13  1  1
 12 14  1  0
 14 15  1  0
 14 16  2  0
 13 17  1  0
 15 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 15  1  0
 20 23  1  0
 19 24  1  0
 24 25  1  0
 17 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4575213

    ---

Associated Targets(non-human)

Trypanosoma congolense (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 430.45Molecular Weight (Monoisotopic): 430.1628AlogP: 3.48#Rotatable Bonds: 10
Polar Surface Area: 119.36Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.46CX Basic pKa: CX LogP: 3.29CX LogD: 3.00
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: 0.70

References

1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K..  (2019)  Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity.,  82  (4): [PMID:30896183] [10.1021/acs.jnatprod.8b00670]

Source