2-(3-(3-fluorobenzamido)phenyl)-4-((4-(4-methylpiperazin-1-yl)phenyl)amino)thiazole-5-carboxylic acid

ID: ALA4575423

PubChem CID: 155563694

Max Phase: Preclinical

Molecular Formula: C28H26FN5O3S

Molecular Weight: 531.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(Nc3nc(-c4cccc(NC(=O)c5cccc(F)c5)c4)sc3C(=O)O)cc2)CC1

Standard InChI:  InChI=1S/C28H26FN5O3S/c1-33-12-14-34(15-13-33)23-10-8-21(9-11-23)30-25-24(28(36)37)38-27(32-25)19-5-3-7-22(17-19)31-26(35)18-4-2-6-20(29)16-18/h2-11,16-17,30H,12-15H2,1H3,(H,31,35)(H,36,37)

Standard InChI Key:  QVCCBJLRSCGOAF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   34.4056  -10.8463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2306  -10.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4874  -10.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8181   -9.5754    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.1530  -10.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7147  -11.5144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5354  -11.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0154  -12.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8353  -12.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1725  -11.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6836  -10.5883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8655  -10.6765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9892  -11.1738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4732  -11.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2903  -11.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6298  -11.0068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1458  -10.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3223  -10.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4506  -10.9235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3704   -9.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1997   -9.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4157   -8.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8019   -9.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9773  -10.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7610  -10.3612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2442   -7.9402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4596   -7.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2880   -6.8782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8464   -8.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0648   -7.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4520   -8.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6232   -9.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4127   -9.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0222   -9.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2758   -9.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8882  -10.3593    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.4485   -8.9995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6674   -8.2769    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
 16 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  5 20  1  0
 22 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 35 36  2  0
 35 37  1  0
  3 35  1  0
 31 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4575423

    ---

Associated Targets(Human)

Raji (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ramos (1218 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 531.61Molecular Weight (Monoisotopic): 531.1740AlogP: 5.40#Rotatable Bonds: 7
Polar Surface Area: 97.80Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.19CX Basic pKa: 7.97CX LogP: 4.24CX LogD: 4.16
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.89

References

1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y..  (2019)  Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines.,  178  [PMID:31234030] [10.1016/j.ejmech.2019.06.035]

Source