5-(4-(2-Fluorophenyl)-1H-1,2,3-triazol-1-yl)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic Acid

ID: ALA4575573

PubChem CID: 135357075

Max Phase: Preclinical

Molecular Formula: C26H23FN4O2

Molecular Weight: 442.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3ccccc3F)nn2)c1

Standard InChI:  InChI=1S/C26H23FN4O2/c27-24-4-2-1-3-23(24)25-16-31(30-29-25)22-14-20(13-21(15-22)26(32)33)18-7-5-17(6-8-18)19-9-11-28-12-10-19/h1-8,13-16,19,28H,9-12H2,(H,32,33)

Standard InChI Key:  RNSOQFFIWXNKIQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   14.9570   -3.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7724   -3.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1793   -2.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7720   -2.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9534   -2.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5502   -2.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9927   -2.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4006   -3.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2170   -3.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6266   -2.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2138   -2.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3987   -2.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4420   -2.9513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8502   -3.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6638   -3.6615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0755   -2.9551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6673   -2.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8475   -2.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5422   -1.5454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9481   -0.8361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7250   -1.5484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5491   -4.3697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7365   -4.4554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5668   -5.2547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2746   -5.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8817   -5.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3587   -6.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6961   -6.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7813   -7.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5286   -8.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1914   -7.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1029   -6.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9498   -6.6204    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
  1 22  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 27  1  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4575573

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.49Molecular Weight (Monoisotopic): 442.1805AlogP: 4.91#Rotatable Bonds: 5
Polar Surface Area: 80.04Molecular Species: ZWITTERIONHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.85CX Basic pKa: 10.07CX LogP: 2.79CX LogD: 2.79
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -1.09

References

1. Junker A, Balasubramanian R, Ciancetta A, Uliassi E, Kiselev E, Martiriggiano C, Trujillo K, Mtchedlidze G, Birdwell L, Brown KA, Harden TK, Jacobson KA..  (2016)  Structure-Based Design of 3-(4-Aryl-1H-1,2,3-triazol-1-yl)-Biphenyl Derivatives as P2Y14 Receptor Antagonists.,  59  (13): [PMID:27331270] [10.1021/acs.jmedchem.6b00044]

Source