The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(3-((2-Aminoethyl)disulfaneyl)propoxy)-5-(2-((2-hydroxy-3-(4-(1-methyl-4-(trifluoromethyl)-1H-imidazol-2-yl)phenoxy)propyl)amino)ethoxy)benzamide ID: ALA4576034
PubChem CID: 155564274
Max Phase: Preclinical
Molecular Formula: C28H36F3N5O5S2
Molecular Weight: 643.75
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(C(F)(F)F)nc1-c1ccc(OC[C@@H](O)CNCCOc2ccc(OCCCSSCCN)c(C(N)=O)c2)cc1
Standard InChI: InChI=1S/C28H36F3N5O5S2/c1-36-17-25(28(29,30)31)35-27(36)19-3-5-21(6-4-19)41-18-20(37)16-34-10-12-39-22-7-8-24(23(15-22)26(33)38)40-11-2-13-42-43-14-9-32/h3-8,15,17,20,34,37H,2,9-14,16,18,32H2,1H3,(H2,33,38)/t20-/m0/s1
Standard InChI Key: GMJGXEAJZMTGIE-FQEVSTJZSA-N
Molfile:
RDKit 2D
43 45 0 0 0 0 0 0 0 0999 V2000
25.4939 -26.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2016 -26.3565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9093 -26.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6170 -26.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3247 -26.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6170 -25.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0324 -26.3565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7401 -26.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4479 -26.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7866 -26.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0794 -26.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0790 -27.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7917 -27.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4960 -27.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3743 -27.9929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6273 -27.6616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0813 -28.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4908 -28.9768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2899 -28.8057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8979 -29.3517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2684 -28.1853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9351 -27.4392 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.7890 -28.8470 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.1556 -26.7651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8633 -26.3565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5700 -26.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2772 -26.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2777 -25.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5650 -25.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8607 -25.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9847 -26.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6926 -26.3617 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9843 -27.5871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9848 -25.1334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6931 -25.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4002 -25.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4752 -27.9702 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.1085 -25.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8157 -25.1296 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.5239 -25.5373 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.2311 -25.1278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9393 -25.5354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6465 -25.1259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 1 1
5 7 1 0
7 8 1 0
8 9 1 0
1 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 1 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
12 15 1 0
19 20 1 0
17 21 1 0
21 22 1 0
21 23 1 0
9 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
27 31 1 0
31 32 1 0
31 33 2 0
28 34 1 0
34 35 1 0
35 36 1 0
21 37 1 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 643.75Molecular Weight (Monoisotopic): 643.2110AlogP: 3.72#Rotatable Bonds: 19Polar Surface Area: 146.88Molecular Species: BASEHBA: 11HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.21CX Basic pKa: 9.61CX LogP: 2.71CX LogD: -0.82Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.11Np Likeness Score: -0.77
References 1. Schwalbe T, Huebner H, Gmeiner P.. (2019) Development of covalent antagonists for β1- and β2-adrenergic receptors., 27 (13): [PMID:31151791 ] [10.1016/j.bmc.2019.05.034 ]