The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[(4-tert-butylphenyl)methyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]-N-[4-(hydroxycarbamoyl)phenyl]acetamide ID: ALA4576056
PubChem CID: 155564305
Max Phase: Preclinical
Molecular Formula: C27H30FN3O5S
Molecular Weight: 527.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(CC(=O)N(Cc1ccc(C(C)(C)C)cc1)c1ccc(C(=O)NO)cc1)S(=O)(=O)c1ccc(F)cc1
Standard InChI: InChI=1S/C27H30FN3O5S/c1-27(2,3)21-9-5-19(6-10-21)17-31(23-13-7-20(8-14-23)26(33)29-34)25(32)18-30(4)37(35,36)24-15-11-22(28)12-16-24/h5-16,34H,17-18H2,1-4H3,(H,29,33)
Standard InChI Key: LINKSTNVTLNRAZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
21.8743 -15.4276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4657 -16.1375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.2869 -16.1328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9190 -17.3838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9179 -18.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6300 -18.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3438 -18.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3410 -17.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6282 -16.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6258 -16.1495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3364 -15.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9128 -15.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0495 -16.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7601 -15.7346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7576 -14.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6298 -19.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3416 -19.8507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3414 -20.6720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9179 -19.8503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3340 -14.9175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4697 -16.9588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7617 -17.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7653 -18.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4755 -18.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1877 -18.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1806 -17.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4806 -19.4211 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.9083 -14.9259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6146 -14.5164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6104 -13.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9000 -13.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1922 -13.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1998 -14.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8944 -12.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5993 -12.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1839 -12.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8874 -11.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
10 12 1 0
11 13 1 0
13 14 1 0
14 2 1 0
14 15 1 0
6 16 1 0
16 17 1 0
17 18 1 0
16 19 2 0
11 20 2 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
12 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.62Molecular Weight (Monoisotopic): 527.1890AlogP: 4.10#Rotatable Bonds: 8Polar Surface Area: 107.02Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.20CX Basic pKa: ┄CX LogP: 4.06CX LogD: 4.06Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.81
References 1. Shouksmith AE, Gawel JM, Nawar N, Sina D, Raouf YS, Bukhari S, He L, Johns AE, Manaswiyoungkul P, Olaoye OO, Cabral AD, Sedighi A, de Araujo ED, Gunning PT.. (2020) Class I/IIb-Selective HDAC Inhibitor Exhibits Oral Bioavailability and Therapeutic Efficacy in Acute Myeloid Leukemia., 11 (1): [PMID:31938464 ] [10.1021/acsmedchemlett.9b00471 ]