Ethyl 4-(8-Methoxy-2-(4-methylpiperazin-1-yl)-4-oxoquinazolin-3(4H)-yl)-benzoate

ID: ALA4576070

PubChem CID: 155564316

Max Phase: Preclinical

Molecular Formula: C21H24N4O2

Molecular Weight: 364.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc2c(=O)n(-c3ccc(C)cc3)c(N3CCN(C)CC3)nc12

Standard InChI:  InChI=1S/C21H24N4O2/c1-15-7-9-16(10-8-15)25-20(26)17-5-4-6-18(27-3)19(17)22-21(25)24-13-11-23(2)12-14-24/h4-10H,11-14H2,1-3H3

Standard InChI Key:  ZIHDFZJUSLRJPV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   21.7491   -2.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7479   -3.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4560   -3.6759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4542   -2.0385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1628   -2.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1662   -3.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8786   -3.6764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5921   -3.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5887   -2.4380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8718   -2.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8673   -1.2088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2941   -2.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0034   -2.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7094   -2.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7073   -1.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9933   -0.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2903   -1.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3010   -3.6698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3001   -4.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0048   -4.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7138   -4.4867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7136   -3.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0043   -3.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4211   -4.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4545   -4.4931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4158   -0.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1615   -4.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  9 12  1  0
  8 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
  3 25  1  0
 15 26  1  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4576070

    ---

Associated Targets(Human)

TRPV4 Tchem Transient receptor potential cation channel subfamily V member 4 (774 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.45Molecular Weight (Monoisotopic): 364.1899AlogP: 2.45#Rotatable Bonds: 3
Polar Surface Area: 50.60Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.31CX LogP: 3.12CX LogD: 2.86
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.71Np Likeness Score: -1.22

References

1. Atobe M, Nagami T, Muramatsu S, Ohno T, Kitagawa M, Suzuki H, Ishiguro M, Watanabe A, Kawanishi M..  (2019)  Discovery of Novel Transient Receptor Potential Vanilloid 4 (TRPV4) Agonists as Regulators of Chondrogenic Differentiation: Identification of Quinazolin-4(3 H)-ones and in Vivo Studies on a Surgically Induced Rat Model of Osteoarthritis.,  62  (3): [PMID:30629441] [10.1021/acs.jmedchem.8b01615]

Source