The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl (E)-3-(2-oxo-1-(3-(trifluoromethyl)phenyl)-1,2-dihydrooxazolo[5,4-c]quinolin-8-yl)acrylate ID: ALA4576178
PubChem CID: 155249665
Max Phase: Preclinical
Molecular Formula: C21H13F3N2O4
Molecular Weight: 414.34
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C=C/c1ccc2ncc3oc(=O)n(-c4cccc(C(F)(F)F)c4)c3c2c1
Standard InChI: InChI=1S/C21H13F3N2O4/c1-29-18(27)8-6-12-5-7-16-15(9-12)19-17(11-25-16)30-20(28)26(19)14-4-2-3-13(10-14)21(22,23)24/h2-11H,1H3/b8-6+
Standard InChI Key: SPDOYRYNLQXJEX-SOFGYWHQSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
17.4531 -26.0506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4520 -26.8779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1668 -27.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1650 -25.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8804 -26.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8811 -26.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5965 -27.2848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3115 -26.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5897 -25.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3032 -26.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9140 -25.4868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5779 -24.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7595 -24.8229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9891 -24.0201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2087 -24.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4640 -23.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9116 -22.8160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1040 -22.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8516 -23.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4056 -24.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1655 -22.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9723 -21.8585 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.6127 -21.4186 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.5713 -21.3130 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.7385 -25.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0241 -26.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3095 -25.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5952 -26.0513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8806 -25.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3093 -24.8135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
12 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
17 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
1 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.34Molecular Weight (Monoisotopic): 414.0827AlogP: 4.34#Rotatable Bonds: 3Polar Surface Area: 74.33Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.68CX LogP: 4.43CX LogD: 4.43Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -0.85
References 1. Hao T, Li Y, Fan S, Li W, Wang S, Li S, Cao R, Zhong W.. (2019) Design, synthesis and pharmacological evaluation of a novel mTOR-targeted anti-EV71 agent., 175 [PMID:31082764 ] [10.1016/j.ejmech.2019.04.048 ]