The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Urundeuvine F ID: ALA4576261
PubChem CID: 155551861
Max Phase: Preclinical
Molecular Formula: C30H24O9
Molecular Weight: 528.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(O)cc1O)[C@@H]1[C@H](c2ccc(O)cc2)c2cc(O)c(O)cc2[C@H](O)[C@@H]1C(=O)c1ccc(O)cc1
Standard InChI: InChI=1S/C30H24O9/c31-16-5-1-14(2-6-16)25-20-12-23(35)24(36)13-21(20)30(39)27(28(37)15-3-7-17(32)8-4-15)26(25)29(38)19-10-9-18(33)11-22(19)34/h1-13,25-27,30-36,39H/t25-,26-,27+,30+/m1/s1
Standard InChI Key: IBYGLVXYEWGFAW-KWWFCQITSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
28.5265 -5.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5230 -6.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2250 -6.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9323 -6.0528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2320 -4.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9343 -5.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6417 -4.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6481 -4.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9411 -3.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2366 -4.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3582 -3.6189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2227 -7.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9293 -7.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5139 -7.6836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7479 -6.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1558 -6.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9706 -6.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3772 -6.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9630 -5.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1496 -5.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9256 -8.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6313 -8.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3412 -8.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3409 -7.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6345 -7.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9442 -2.7940 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2163 -8.9090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0482 -8.9167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.1944 -6.0446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8135 -6.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1076 -6.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8101 -7.2733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8195 -4.8234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1137 -5.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4086 -4.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6982 -5.2226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6973 -6.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4030 -6.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9917 -4.8119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 5 1 0
2 3 1 0
3 4 1 0
6 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
3 12 1 1
12 13 1 0
12 14 2 0
4 15 1 1
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 13 1 0
9 26 1 0
21 27 1 0
23 28 1 0
18 29 1 0
2 30 1 1
30 31 1 0
30 32 2 0
1 33 1 1
31 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 31 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.51Molecular Weight (Monoisotopic): 528.1420AlogP: 4.10#Rotatable Bonds: 5Polar Surface Area: 175.75Molecular Species: NEUTRALHBA: 9HBD: 7#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.48CX Basic pKa: ┄CX LogP: 4.55CX LogD: 4.25Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: 0.77
References 1. Menezes JCJMDS, Diederich MF.. (2019) Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology., 182 [PMID:31494471 ] [10.1016/j.ejmech.2019.111637 ]