Urundeuvine F

ID: ALA4576261

PubChem CID: 155551861

Max Phase: Preclinical

Molecular Formula: C30H24O9

Molecular Weight: 528.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(O)cc1O)[C@@H]1[C@H](c2ccc(O)cc2)c2cc(O)c(O)cc2[C@H](O)[C@@H]1C(=O)c1ccc(O)cc1

Standard InChI:  InChI=1S/C30H24O9/c31-16-5-1-14(2-6-16)25-20-12-23(35)24(36)13-21(20)30(39)27(28(37)15-3-7-17(32)8-4-15)26(25)29(38)19-10-9-18(33)11-22(19)34/h1-13,25-27,30-36,39H/t25-,26-,27+,30+/m1/s1

Standard InChI Key:  IBYGLVXYEWGFAW-KWWFCQITSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   28.5265   -5.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5230   -6.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2250   -6.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9323   -6.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2320   -4.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9343   -5.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6417   -4.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6481   -4.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9411   -3.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2366   -4.0148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3582   -3.6189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2227   -7.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9293   -7.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5139   -7.6836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7479   -6.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1558   -6.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9706   -6.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3772   -6.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9630   -5.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1496   -5.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9256   -8.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6313   -8.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3412   -8.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3409   -7.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6345   -7.2788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9442   -2.7940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2163   -8.9090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0482   -8.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1944   -6.0446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8135   -6.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1076   -6.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8101   -7.2733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8195   -4.8234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1137   -5.2285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4086   -4.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6982   -5.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6973   -6.0440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4030   -6.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9917   -4.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  5  1  0
  2  3  1  0
  3  4  1  0
  6  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
  3 12  1  1
 12 13  1  0
 12 14  2  0
  4 15  1  1
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 13  1  0
  9 26  1  0
 21 27  1  0
 23 28  1  0
 18 29  1  0
  2 30  1  1
 30 31  1  0
 30 32  2  0
  1 33  1  1
 31 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 31  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4576261

    ---

Associated Targets(Human)

CTSV Tchem Cathepsin L2 (273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.51Molecular Weight (Monoisotopic): 528.1420AlogP: 4.10#Rotatable Bonds: 5
Polar Surface Area: 175.75Molecular Species: NEUTRALHBA: 9HBD: 7
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 7#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.48CX Basic pKa: CX LogP: 4.55CX LogD: 4.25
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: 0.77

References

1. Menezes JCJMDS, Diederich MF..  (2019)  Natural dimers of coumarin, chalcones, and resveratrol and the link between structure and pharmacology.,  182  [PMID:31494471] [10.1016/j.ejmech.2019.111637]

Source