The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,6-dimethyl-5-n-butyl-2-{[4-(o-chlorophenyl)-1-piperazinyl]methyl}pyrrolo[3,4-c]pyrrole-1,3(2H,5H)-dione ID: ALA4576297
PubChem CID: 155552038
Max Phase: Preclinical
Molecular Formula: C23H29ClN4O2
Molecular Weight: 428.96
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCn1c(C)c2c(c1C)C(=O)N(CN1CCN(c3ccccc3Cl)CC1)C2=O
Standard InChI: InChI=1S/C23H29ClN4O2/c1-4-5-10-27-16(2)20-21(17(27)3)23(30)28(22(20)29)15-25-11-13-26(14-12-25)19-9-7-6-8-18(19)24/h6-9H,4-5,10-15H2,1-3H3
Standard InChI Key: YNDJJNHPVFHAAJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
23.5432 -20.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5821 -19.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0806 -19.9198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3611 -19.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3350 -20.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1112 -20.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6172 -19.9976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1536 -19.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4332 -18.5391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3411 -21.4417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2643 -21.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3492 -18.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4418 -20.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8313 -20.7509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3898 -21.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7760 -22.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6008 -22.2073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0379 -21.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6502 -20.7753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2560 -19.8960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8644 -19.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0397 -19.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6482 -18.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9872 -22.9314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5479 -23.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9341 -24.3591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7594 -24.3888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1970 -23.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8083 -22.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2440 -22.2586 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 2 0
2 3 1 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 2 0
6 10 2 0
1 11 1 0
2 12 1 0
7 13 1 0
13 14 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
3 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
17 24 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.96Molecular Weight (Monoisotopic): 428.1979AlogP: 3.93#Rotatable Bonds: 6Polar Surface Area: 48.79Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.89CX LogP: 4.41CX LogD: 4.41Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.43
References 1. Redzicka A, Szczukowski Ł, Kochel A, Wiatrak B, Gębczak K, Czyżnikowska Ż.. (2019) COX-1/COX-2 inhibition activities and molecular docking study of newly designed and synthesized pyrrolo[3,4-c]pyrrole Mannich bases., 27 (17): [PMID:31345747 ] [10.1016/j.bmc.2019.07.033 ]