The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 3-((2-amino-6-(4-chlorophenyl)-pyrimidin-4-yl)methyl)-beta-D-galactopyranoside ID: ALA4576450
PubChem CID: 155551949
Max Phase: Preclinical
Molecular Formula: C18H22ClN3O6
Molecular Weight: 411.84
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](OCc2cc(-c3ccc(Cl)cc3)nc(N)n2)[C@H]1O
Standard InChI: InChI=1S/C18H22ClN3O6/c1-26-17-15(25)16(14(24)13(7-23)28-17)27-8-11-6-12(22-18(20)21-11)9-2-4-10(19)5-3-9/h2-6,13-17,23-25H,7-8H2,1H3,(H2,20,21,22)/t13-,14+,15-,16+,17-/m1/s1
Standard InChI Key: RNGXGXAJHZLJRH-BPKGMFCQSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
5.1301 -14.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1301 -15.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8396 -15.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5490 -15.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5490 -14.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8396 -13.9046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2620 -13.9108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8396 -16.3686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4189 -15.5524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4171 -13.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4147 -13.0895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9726 -14.3215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2602 -15.5524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1318 -16.7772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1318 -17.5944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4210 -17.9997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4206 -18.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1289 -19.2255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8389 -18.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8358 -17.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7127 -19.2243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5444 -19.2164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5459 -20.0346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2542 -20.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9615 -20.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9559 -19.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2471 -18.8058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6712 -20.4347 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 1
3 8 1 1
2 9 1 1
1 10 1 1
10 11 1 0
7 12 1 0
4 13 1 6
8 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
17 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
19 22 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.84Molecular Weight (Monoisotopic): 411.1197AlogP: 0.35#Rotatable Bonds: 6Polar Surface Area: 140.18Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.28CX Basic pKa: 4.04CX LogP: 0.72CX LogD: 0.72Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: 0.56
References 1. Dahlqvist A, Zetterberg FR, Leffler H, Nilsson UJ.. (2019) Aminopyrimidine-galactose hybrids are highly selective galectin-3 inhibitors., 10 (6): [PMID:31303989 ] [10.1039/C9MD00183B ]