The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-((R)-3-(3,4-dimethoxyphenyl)-1-(((S)-1-((1R,2S,4aS,8aR)-2-methyl-decahydronaphthalene-1-carbonyl)piperidine-2-carbonyl)oxy)propyl)phenoxy)acetic acid ID: ALA4576541
PubChem CID: 155554017
Max Phase: Preclinical
Molecular Formula: C37H49NO8
Molecular Weight: 635.80
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC[C@@H](OC(=O)[C@@H]2CCCCN2C(=O)[C@H]2[C@@H]3CCCC[C@H]3CC[C@@H]2C)c2cccc(OCC(=O)O)c2)cc1OC
Standard InChI: InChI=1S/C37H49NO8/c1-24-14-17-26-9-4-5-12-29(26)35(24)36(41)38-20-7-6-13-30(38)37(42)46-31(27-10-8-11-28(22-27)45-23-34(39)40)18-15-25-16-19-32(43-2)33(21-25)44-3/h8,10-11,16,19,21-22,24,26,29-31,35H,4-7,9,12-15,17-18,20,23H2,1-3H3,(H,39,40)/t24-,26-,29+,30-,31+,35+/m0/s1
Standard InChI Key: GVLRYZOQUIJRPO-APMODGHASA-N
Molfile:
RDKit 2D
48 52 0 0 0 0 0 0 0 0999 V2000
4.0556 -2.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0545 -3.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7667 -4.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4805 -3.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4776 -2.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7649 -2.4637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1929 -4.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1942 -4.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9067 -5.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9080 -6.1574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6179 -4.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3240 -5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0347 -4.9256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0339 -4.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3164 -3.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6128 -4.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1968 -6.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4843 -6.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1981 -7.3926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4887 -5.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7803 -4.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0666 -5.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0660 -6.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7789 -6.5765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3423 -4.1083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6308 -3.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3437 -2.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3435 -1.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7470 -5.3335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4584 -4.9241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1707 -5.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8821 -4.9226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1715 -6.1533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7811 -7.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4941 -7.8045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0704 -7.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3595 -7.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6509 -7.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6490 -8.6334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0766 -8.6335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3662 -9.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3669 -9.8617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0763 -10.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7867 -9.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7876 -9.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7835 -8.2173 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6497 -9.4472 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.3575 -6.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 6
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
10 17 1 0
18 17 1 1
17 19 2 0
18 20 1 0
18 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
2 25 1 0
25 26 1 0
1 27 1 0
27 28 1 0
13 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
24 34 1 0
34 35 2 0
36 34 1 1
36 37 1 0
36 40 1 0
37 38 1 0
38 39 1 0
39 41 1 0
40 41 1 0
40 45 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
40 46 1 1
41 47 1 6
37 48 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 635.80Molecular Weight (Monoisotopic): 635.3458AlogP: 6.62#Rotatable Bonds: 12Polar Surface Area: 111.60Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.44CX Basic pKa: 1.09CX LogP: 6.75CX LogD: 3.36Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.26Np Likeness Score: 0.09
References 1. Feng X, Sippel C, Knaup FH, Bracher A, Staibano S, Romano MF, Hausch F.. (2020) A Novel Decalin-Based Bicyclic Scaffold for FKBP51-Selective Ligands., 63 (1): [PMID:31800244 ] [10.1021/acs.jmedchem.9b01157 ]