4-(4-(4-(1-Cyclopentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)piperidin-1-yl)butoxy)benzonitrile

ID: ALA4576593

PubChem CID: 155553832

Max Phase: Preclinical

Molecular Formula: C30H39N3O

Molecular Weight: 457.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(OCCCCN2CCC(C3(C4CCCC4)NCCc4ccccc43)CC2)cc1

Standard InChI:  InChI=1S/C30H39N3O/c31-23-24-11-13-28(14-12-24)34-22-6-5-19-33-20-16-27(17-21-33)30(26-8-2-3-9-26)29-10-4-1-7-25(29)15-18-32-30/h1,4,7,10-14,26-27,32H,2-3,5-6,8-9,15-22H2

Standard InChI Key:  ZUHLVCWHTWLFOX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   10.4001  -12.9239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3990  -13.7503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1130  -14.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8287  -13.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1112  -12.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8250  -12.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5323  -12.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5321  -11.6874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8183  -11.2782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.1048  -11.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6846  -10.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0195  -10.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3976   -9.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6782  -10.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8557  -10.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3017  -11.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7200  -11.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9198  -11.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6949  -12.3120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2766  -12.9052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0832  -12.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8917  -12.5202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3138  -11.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5160  -12.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9380  -11.5519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1403  -11.7586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5623  -11.1711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7846  -10.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2074   -9.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4087   -9.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1903  -10.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7689  -11.3824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8282   -9.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2495   -8.8272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  1  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 33 34  3  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4576593

    ---

Associated Targets(Human)

MEN1 Tchem Menin (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.66Molecular Weight (Monoisotopic): 457.3093AlogP: 5.66#Rotatable Bonds: 8
Polar Surface Area: 48.29Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.11CX LogP: 5.79CX LogD: 1.17
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.50

References

1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S..  (2019)  Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction.,  62  (13): [PMID:31244110] [10.1021/acs.jmedchem.9b00021]

Source