The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(4-(1-Cyclopentyl-1,2,3,4-tetrahydroisoquinolin-1-yl)piperidin-1-yl)butoxy)benzonitrile ID: ALA4576593
PubChem CID: 155553832
Max Phase: Preclinical
Molecular Formula: C30H39N3O
Molecular Weight: 457.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(OCCCCN2CCC(C3(C4CCCC4)NCCc4ccccc43)CC2)cc1
Standard InChI: InChI=1S/C30H39N3O/c31-23-24-11-13-28(14-12-24)34-22-6-5-19-33-20-16-27(17-21-33)30(26-8-2-3-9-26)29-10-4-1-7-25(29)15-18-32-30/h1,4,7,10-14,26-27,32H,2-3,5-6,8-9,15-22H2
Standard InChI Key: ZUHLVCWHTWLFOX-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
10.4001 -12.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3990 -13.7503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1130 -14.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8287 -13.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1112 -12.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8250 -12.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5323 -12.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5321 -11.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8183 -11.2782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1048 -11.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6846 -10.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0195 -10.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3976 -9.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6782 -10.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8557 -10.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3017 -11.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7200 -11.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9198 -11.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6949 -12.3120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2766 -12.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0832 -12.6993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8917 -12.5202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3138 -11.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5160 -12.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9380 -11.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1403 -11.7586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5623 -11.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7846 -10.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2074 -9.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4087 -9.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1903 -10.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7689 -11.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8282 -9.4139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2495 -8.8272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 1 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
10 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 34 3 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.66Molecular Weight (Monoisotopic): 457.3093AlogP: 5.66#Rotatable Bonds: 8Polar Surface Area: 48.29Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.11CX LogP: 5.79CX LogD: 1.17Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.50
References 1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]