The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E/Z)-N-((S)-1-(((S)-4-Cyano-1-((S)-2-oxopiperidin-3-yl)pent-3-en-2-yl)amino)-3-(4-fluorophenyl)-1-oxopropan-2-yl)-5-methylisoxazole-3-carboxamide ID: ALA4576602
PubChem CID: 155554147
Max Phase: Preclinical
Molecular Formula: C25H28FN5O4
Molecular Weight: 481.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C#N)=C[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1cc(C)on1
Standard InChI: InChI=1S/C25H28FN5O4/c1-15(14-27)10-20(13-18-4-3-9-28-23(18)32)29-24(33)21(12-17-5-7-19(26)8-6-17)30-25(34)22-11-16(2)35-31-22/h5-8,10-11,18,20-21H,3-4,9,12-13H2,1-2H3,(H,28,32)(H,29,33)(H,30,34)/t18-,20+,21-/m0/s1
Standard InChI Key: GGJRXRHPMDJCPP-TYPHKJRUSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
18.0015 -14.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7208 -13.5921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2863 -13.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0015 -14.8296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4360 -14.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1512 -13.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8663 -14.0032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1512 -12.8537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4360 -14.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1512 -15.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1466 -16.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8609 -16.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5770 -16.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5744 -15.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8595 -14.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2927 -16.4825 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.5814 -13.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2965 -14.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0118 -13.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7269 -14.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1994 -12.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3910 -12.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9799 -13.3106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5315 -13.9235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0573 -11.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5814 -12.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2965 -12.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0057 -12.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7187 -12.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7229 -11.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0080 -10.7940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2887 -11.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0118 -12.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5725 -10.7939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4454 -14.4127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
5 9 1 6
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
13 16 1 0
17 7 1 1
17 18 1 0
18 19 2 3
19 20 1 0
3 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 3 2 0
22 25 1 0
17 26 1 0
27 26 1 1
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
19 33 1 0
32 34 2 0
20 35 3 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.53Molecular Weight (Monoisotopic): 481.2125AlogP: 2.33#Rotatable Bonds: 9Polar Surface Area: 137.12Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.44CX Basic pKa: ┄CX LogP: 2.03CX LogD: 2.03Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -0.57
References 1. Ma Y, Li L, He S, Shang C, Sun Y, Liu N, Meek TD, Wang Y, Shang L.. (2019) Application of Dually Activated Michael Acceptor to the Rational Design of Reversible Covalent Inhibitor for Enterovirus 71 3C Protease., 62 (13): [PMID:31184893 ] [10.1021/acs.jmedchem.9b00387 ]