2-((5aS,6S,8S,9aR)-6-acetoxy-5a-methyl-1,10-dioxo-3-(pyridin-3-yl)-1,5a,6,7,8,9,9a,10-octahydropyrano[4,3-b]chromen-8-yl)propane-1,2-diyl diacetate

ID: ALA4576639

PubChem CID: 134188217

Max Phase: Preclinical

Molecular Formula: C27H29NO10

Molecular Weight: 527.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OCC(C)(OC(C)=O)[C@@H]1C[C@H](OC(C)=O)[C@@]2(C)Oc3cc(-c4cccnc4)oc(=O)c3C(=O)[C@@H]2C1

Standard InChI:  InChI=1S/C27H29NO10/c1-14(29)34-13-26(4,37-16(3)31)18-9-19-24(32)23-21(38-27(19,5)22(10-18)35-15(2)30)11-20(36-25(23)33)17-7-6-8-28-12-17/h6-8,11-12,18-19,22H,9-10,13H2,1-5H3/t18-,19-,22-,26?,27-/m0/s1

Standard InChI Key:  KCJBHQGKTRQNLF-PQTUVYCNSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   16.1427  -16.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5668  -17.4177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8548  -16.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5650  -16.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2796  -16.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2902  -15.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5800  -14.9486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8591  -15.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8548  -17.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1427  -17.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4369  -17.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4371  -18.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1490  -19.0565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8610  -18.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1482  -14.9346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4270  -16.1823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7232  -19.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5774  -19.0541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0079  -18.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7244  -19.8869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0067  -17.8253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2916  -17.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2903  -16.5888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5777  -17.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8469  -17.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1385  -18.2428    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.0082  -14.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7181  -15.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4369  -14.9837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4469  -14.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7321  -13.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0163  -14.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5809  -19.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2971  -20.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8681  -20.2947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7176  -18.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0105  -20.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0118  -21.1256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2954  -19.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  1  0
  1  3  1  0
  9  2  1  0
  2  4  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  8 15  2  0
  1 16  2  0
 12 17  1  1
 14 18  1  1
 17 19  1  0
 17 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
  9 25  1  1
 10 26  1  6
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  6 27  1  0
 18 33  1  0
 33 34  1  0
 33 35  2  0
 17 36  1  0
 20 37  1  0
 37 38  2  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4576639

    ---

Associated Targets(Human)

SOAT2 Tchem Acyl coenzyme A:cholesterol acyltransferase 2 (288 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.53Molecular Weight (Monoisotopic): 527.1791AlogP: 2.88#Rotatable Bonds: 6
Polar Surface Area: 148.30Molecular Species: NEUTRALHBA: 11HBD:
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 4.21CX LogP: 0.97CX LogD: 0.97
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.40Np Likeness Score: 1.22

References

1.  (2016)  Class of tricyclic analogue, preparation method and use thereof, 

Source